Tsumeb Mine (Ongopolo Mine), Tsumeb, Oshikoto Region, Namibiai
| Regional Level Types | |
|---|---|
| Tsumeb Mine (Ongopolo Mine) | Mine (Inactive) |
| Tsumeb | Constituency |
| Oshikoto Region | Region |
| Namibia | Country |
This page kindly sponsored by Marcus J. Origlieri, Ph.D.
Latitude & Longitude (WGS84):
19° 13' 37'' South , 17° 43' 39'' East
Latitude & Longitude (decimal):
Type:
Mine (Inactive) - last checked 2018
Deposit first discovered:
1893
Age:
1000 to 541 ± 1.0 Ma
Geologic Time:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Tsumeb | 12,190 (2013) | 1.3km |
| Grootfontein | 24,099 (2014) | 55.6km |
| Otavi | 4,562 (2012) | 62.6km |
Other/historical names associated with this locality:
Tsumcorp Mine
Other Languages:
Afrikaans:
Tsumeb, Tsumeb, Osjikoto, Namibië
French:
Tsumeb, Tsumeb, Oshikoto, Namibie
German:
Tsumeb Mine, Tsumeb, Oshikoto, Namibia
Italian:
Tsumeb, Tsumeb, Regione di Oshikoto, Namibia
Russian:
Цумеб, Цумеб, Ошикото, Намибия
Simplified Chinese:
楚梅布, 楚梅布, 奧希科托區, 纳米比亚
Spanish:
Tsumeb, Tsumeb, Región de Oshikoto, Namibia
Belarusian:
Цумеб, Намібія
Bulgarian:
Цумеб, Цумеб, Ошикото, Намибия
Catalan:
Tsumeb, Tsumeb, Namíbia
Cebuano:
Tsumeb, Tsumeb, Oshikoto, Namibya
Danish:
Tsumeb, Tsumeb, Namibia
Dutch:
Tsumeb, Tsumeb, Oshikoto, Namibië
Esperanto:
Cumebo, Cumebo, Namibio
Finnish:
Tsumeb, Tsumeb, Oshikoto, Namibia
Greek:
Τσουμέμπ, Τσουμέμπ, Ναμίμπια
Hebrew:
צואמב, צואמב, נמיביה
Japanese:
ツメブ, ツメブ, オシコト州, ナミビア
Korean:
추메브, 추메브, 오시코토 주, 나미비아
Norwegian:
Tsumeb, Oshikoto (region), Namibia
Polish:
Tsumeb, Tsumeb, Oshikoto, Namibia
Romanian:
Tsumeb, Tsumeb, Namibia
Shona:
Tsumeb, Tsumeb, Namibia
Swedish:
Tsumeb, Tsumeb, Namibia
Traditional Chinese:
楚梅布, 納米比亞
Turkish:
Tsumeb, Tsumeb, Oshikoto Bölgesi, Namibya
Ukrainian:
Цумеб, Цумеб, Ошикото, Намібія
Zulu:
Tsumeb, INamibhiya
A world-famous Cu-Pb-Zn-Ag-Ge-Cd mine, renowned for a wealth of rare and unusual minerals. On January 21, 1893, Matthew Rogers discovered the "green hill" and the site started operating in 1907 and closed in 1996 for economic reasons.
However, even before the "official" discovery, the deposit had been known for ages by local Bushmen and exploited by them artisanally to recover copper.
Mineralisation is hosted in Neoproterozoic Otavi Dolomite. The orebody is an ore pipe. It is about 120 by 15 meters in cross-section, steeply dipping and extending from the surface to at least 1,000 meters in depth. Controls for ore emplacement include interrupted circular fracturing, core breccia, and an internal mass of pseudo-aplite (Tsumeb Pipe). Local rocks include mainly Late Proterozoic sedimentary terrane.
Workings include extensive underground openings to a depth of 1,000 meters.
The De Wet shaft is on Main street.
The Mindat Icon shows the surface plant.
Please look for the other icons to see the location of the former " green hill " and exploitation of the early days and also where the De Wet and Friedrich-Wilhelm shaft is situated.
https://kr.htw-berlin.de/files/Stg/KR/Bachelor/Bilder/-5_Doc-and-pre-research_Tsumeb_Shaft_versi_kl-versand_.pdf
Here is the link to a new website, exclusively dedicated to the Tsumeb mine:
https://tmn.fas.harvard.edu/
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities350 valid minerals. 76 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc. 2 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Abellaite Formula: NaPb2(CO3)2(OH) References: Desor, J. (10/2023) SEM-EDS & Raman spectroscopyIdentified by Joy Desor: SEM-EDS, Raman Spectroscopy |
| ⓘ Acanthite Formula: Ag2S |
| ✪ Adamite Formula: Zn2(AsO4)(OH) Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. References: |
| ⓘ Formula: Zn2(AsO4)(OH) Description: Analysis shows less than 0.1% Cobalt, consequently cannot be regarded as 'cobaltoan' |
| ⓘ Formula: (Zn,Cu)2AsO4OH Description: "Cuprian adamite" is primarily Zincolivenite or close to end-member Adamite. References: |
| ⓘ Agardite-(Ce) Formula: CeCu6(AsO4)3(OH)6 · 3H2O |
| ✪ Alamosite Formula: PbSiO3 Habit: divergent sprays Colour: clear / white Description: “Until the nineteen seventies the presence of lead silicates was unknown at Tsumeb. The first lead silicate specimen, alamosite, was discovered during a photographic session at the collection of W.R. Kahn. A piece of aragonite was to be featured, but the specimen that was photographed was slightly too heavy for aragonite. It was composed of radiating 8 cm spray of bundles of elongated, terminated white crystals up to 4 cm. The luster was also different to the known luster of the carbonate. Further examination gave the surprising result that this aragonite was in fact alamosite. This particular specimen is the best alamosite yet found anywhere. Another great specimen belongs to the collection of the Houston Museum. Tsumeb is the only locality from which crystals of alamosite have been reported, and a total of about 20 specimens have been found. Alamosite is often associated with small green-black spheres of melanotekite.”1
Georg Gebhard, Tsumeb, 1999, p163. |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anatase Formula: TiO2 |
| ✪ Andyrobertsite (TL) Formula: KCdCu5(AsO4)4(H2AsO4) · 2H2O Type Locality: Habit: na Colour: Blue |
| ⓘ Anglesite Formula: PbSO4 Description: Some large crystals, over 20cm on edge. |
| ⓘ Anhydrite Formula: CaSO4 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Anorthoroselite Formula: Ca2Co(AsO4)2 · 2H2O |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Aragonite var. Lead-bearing Aragonite Formula: (Ca,Pb)CO3 |
| ⓘ Aragonite var. Zinc-bearing Aragonite Formula: (Ca,Zn)CO3 |
| ⓘ Argutite Formula: GeO2 |
| ⓘ Argyrodite Formula: Ag8GeS6 |
| ⓘ Arsenbrackebuschite (TL) Formula: Pb2Fe3+(AsO4)2(OH) Type Locality: References: |
| ⓘ Arsendescloizite (TL) Formula: PbZn(AsO4)(OH) Type Locality: Colour: orange yellow to greenish Description: ound as yellow tabular crystals intergrown in rose-like aggregates in tennantite ore from Tsumeb…associated with willemite, chalcocite, mimetite, quartz and goethite |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O Habit: radial and granular aggregates Colour: golden-yellow to dark brown Description: Found on specimens from the second oxidation zone, section 49E on the 30th level, in association with carminite, beudantite, anglesite, mimetite, pharmacosiderite and beaverite |
| ⓘ Arsenocrandallite Formula: CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ Arsenogoyazite Formula: SrAl3(AsO4)(AsO3OH)(OH)6 Habit: rhombohedral Colour: milky-white Description: on a single specimen small crystals with quartz and hematite |
| ⓘ Arsenohopeite (TL) Formula: Zn3(AsO4)2 · 4H2O Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) Newsletter 8. Mineralogical Magazine, 75 (2) 289-294 doi:10.1180/minmag.2011.075.2.289 |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Arsentsumebite (TL) Formula: Pb2Cu(AsO4)(SO4)(OH) Type Locality: Description: The most easily recognizable occurrence of arsentsumebite is the emerald- to apple-green crusts on mimetite. Arsentsumebite rims these pseudomorphs, which consists of bayldonite and duftite in the inner part of the host mimetite crystals. The finest specimens of all time were found during the excavation of the 6 level in 1988. Surfaces up to 10 by 5 cm are completely covered by brilliant crystals of arsentsumebite. Crystals are always small, being less than 2 mm. (Gebhard, 1999)
In 1990, workings in the upper levels of the Tsumeb mine produced a quantity of extremely fine azurite specimens. Some specimens are associated with green smithsonite, or have been partially replaced by arsentsumebite. The color combinations are striking, as are the crystals themselves, some of which are nearly 10 cm in length, with excellent luster. ( Mineralogical Record, 1991) |
| ⓘ Arthurite Formula: CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Ashoverite Formula: Zn(OH)2 |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ Austinite Formula: CaZn(AsO4)(OH) |
| ✪ Azurite Formula: Cu3(CO3)2(OH)2 Habit: elongated crystals Colour: bright blue Description: Some crystals are partially or completely altered to malachite. References: Tofoorffy, Z. v. (1913) Über Kupferlasur und Weißbleierz von Tsumeb. Zeitschrift für Kristallographie, 52 (1-6). 225-237 doi:10.1524/zkri.1913.52.1.225 Thomson, Ellis (1917) Azurite from Tsumeb, Ambo-land, Southwest Africa. American Mineralogist, 2 (4) 46-48 |
| ⓘ Baileychlore Formula: (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| ✪ Bartelkeite (TL) Formula: Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O Type Locality: |
| ⓘ Baryte Formula: BaSO4 Habit: Tabular Colour: chocolate-brown Description: Occasionally produced chocolate-brown tabular crystals up to 10cm long. |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 References: |
| ⓘ Beaverite-(Cu) Formula: Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ Bendadaite Formula: Fe2+Fe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ Berthierine Formula: (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ Berzelianite Formula: Cu2-xSe (x ≈ 0.12) |
| ⓘ Betekhtinite Formula: Pb2(Cu,Fe)22-24S15 References: |
| ⓘ Betpakdalite-CaCa Formula: [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] |
| ⓘ Betpakdalite-CaMg (TL) Formula: [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549 Kampf, A. R., Mills, S. J., Rumsey, M. S., Dini, M., Birch, W. D., Spratt, J., Pluth, J. J., Steele, I. M., Jenkins, R. A., Pinch, W. W. (2012) The heteropolymolybdate family: structural relations, nomenclature scheme and new species. Mineralogical Magazine, 76 (5) 1175-1207 doi:10.1180/minmag.2012.076.5.09 |
| ⓘ 'Betpakdalite Group' References: Kampf, A. R., Mills, S. J., Rumsey, M. S., Dini, M., Birch, W. D., Spratt, J., Pluth, J. J., Steele, I. M., Jenkins, R. A., Pinch, W. W. (2012) The heteropolymolybdate family: structural relations, nomenclature scheme and new species. Mineralogical Magazine, 76 (5) 1175-1207 doi:10.1180/minmag.2012.076.5.09 |
| ✪ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 |
| ✪ Biehlite (TL) Formula: ((Sb,As)O)2[MoO4] Type Locality: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Brianyoungite Formula: Zn3(CO3,SO4)(OH)4 References: |
| ⓘ Briartite Formula: Cu2FeGeS4 |
| ⓘ Brindleyite Formula: (Ni,Al)3(Si,Al)2O5(OH)4 References: |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Brucite Formula: Mg(OH)2 |
| ✪ Brunogeierite (TL) Formula: Ge4+Fe2+2O4 Type Locality: |
| ⓘ Cadsulfohite (TL) Formula: Cd2(SO4)(OH)2 Type Locality: |
| ✪ Calcioandyrobertsite (TL) Formula: KCaCu5(AsO4)4(H2AsO4) · 2H2O Type Locality: |
| ⓘ Calcite Formula: CaCO3 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Caledonite Formula: Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ Calvertite (TL) Formula: Cu5Ge0.5S4 Type Locality: |
| ⓘ Carminite Formula: PbFe3+2(AsO4)2(OH)2 |
| ⓘ 'Carnevallite' Formula: Cu3GaS4 |
| ⓘ Carrollite Formula: CuCo2S4 References: |
| ⓘ Celestine Formula: SrSO4 |
| ✪ Cerussite Formula: PbCO3 Description: Crystals are colourless to white, often transparent, known to be over 30 cm in diameter and several kilos in weight. Rare varieties are coloured red or blue by the presence of copper minerals. |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Chalconatronite Formula: Na2Cu(CO3)2 · 3H2O References: Desor, J. (10/2023) SEM-EDS & Raman spectroscopyIdentified by Joy Desor: SEM-EDS, Raman Spectroscopy |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O References: |
| ⓘ Chalcophyllite Formula: Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Chenevixite Formula: Cu2Fe3+2(AsO4)2(OH)4 References: |
| ⓘ Chlorargyrite Formula: AgCl References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ✪ Chudobaite (TL) Formula: (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O Type Locality: |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Claudetite Formula: As2O3 |
| ⓘ Clausthalite Formula: PbSe References: Desor, J. (03/2024) SEM-EDS Identified by Joy Desor: SEM-EDS |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Clinoclase Formula: Cu3(AsO4)(OH)3 References: |
| ⓘ Cobalttsumcorite Formula: PbCo2(AsO4)2 · 2H2O |
| ⓘ Colusite Formula: Cu13VAs3S16 |
| ⓘ Conichalcite Formula: CaCu(AsO4)(OH) |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Cornwallite Formula: Cu5(AsO4)2(OH)4 Habit: Crystalline crusts Colour: Green Description: Found covering quartz with malachite and bayldonite. |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cotunnite Formula: PbCl2 References: |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Cubanite Formula: CuFe2S3 |
| ✪ Cuprite Formula: Cu2O |
| ⓘ Cuprite var. Chalcotrichite Formula: Cu2O |
| ⓘ Cupropearceite Formula: [Cu6As2S7][Ag9CuS4] |
| ⓘ Cupropolybasite Formula: [Cu6Sb2S7][Ag9CuS4] |
| ⓘ Davidlloydite (TL) Formula: Zn3(AsO4)2 · 4H2O Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549 Hawthorne, Frank C., Cooper, Mark A., Abdu, Yassir A., Ball, Neil A., Back, Malcolm E., Tait, Kim T. (2012) Davidlloydite, ideally Zn3(AsO4)2(H2O)4, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (1) 45-57 doi:10.1180/minmag.2012.076.1.45 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) Colour: Reddish brown to dark brown Description: Very small mm crystals, also masses, dendritic aggregates to 1cm size and stalactites. Many specimens labelled from Tsumeb are more likely from other prolific localities; Abenab, Berg Aukas, Grootfontein, Guchab, Olifantsfontein and Uitsab, all within 100km of Tsumeb (Refs: MR-Tsumeb!). References: |
| ⓘ Devilline Formula: CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ Digenite Formula: Cu9S5 |
| ✪ Dioptase Formula: CuSiO3 · H2O |
| ⓘ Djurleite Formula: Cu31S16 References: |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Dolomite var. Cobalt-bearing Dolomite Formula: (Ca,Mg,Co)CO3 |
| ⓘ Dolomite var. Zinc-bearing Dolomite Formula: Ca(Mg,Zn)(CO3)2 |
| ⓘ Dufrénite Formula: Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ Duftite (TL) Formula: PbCu(AsO4)(OH) Type Locality: Description: Guillemin (1956) proposed that compositions close to end member duftite – PbCu(AsO4)(OH) – are isostructural with descloizite. He called duftites of this composition α-duftite and found that it could readily be synthesised in the laboratory. However, he also found that certain duftites with more than about 20% substitution of calcium for lead were isomorphous with conichalcite and could not be synthesised. He proposed the name β-duftite for these compositions and suggested that β-duftite forms a series with conichalcite.
The distinction between these two “polymorphs” was quite important at Tsumeb in the 1970s and 1980s, because they accounted for a significant proportion of the lead (and to a smaller extent copper) in certain ore types but responded quite differently to the flotation process in the concentrator. Because of this, former Tsumeb Corporation mineralogist John Innes encouraged various technical and academic studies of these minerals. The “duftite problem” has been discussed by several authors, but the most relevant to a simple explanation are as follows:
Jambor et al. (1980) examined a series of calcian duftite and plumbian conichalcite specimens from Tsumeb and concluded that complete solid solution probably exists between the duftite and conichalcite, and they proposed that β-duftite is merely an intermediate in the duftite-conichalcite series (as opposed to a distinct polymorph).
Kharisun et al. (1998) studied the structure of duftite, conichalcite and of intermediate compositions. They agreed with Jambor et al. (1980) that “β-duftite” is not a distinct mineral but rather a composition, or series of compositions, within the duftite-conichalcite series. However, the relationship is not one of simple solid solution; instead, modulated structures comprising domains of different composition occur. This explains why Guillemin (1956) had been unable to synthesise his beta polymorph, but it also indicates that “β-duftite” is not a valid mineral!
Burke (2006) included “duftite-beta” among minerals officially discredited by the IMA.
So much for “β-duftite”, but it is interesting (to us Tsumeb geeks anyway) that Jambor et al. (1980) also demonstrated extensive solid solution between conichalcite and austinite. They noted, though, that no compositions with both Pb>Ca and Zn>Cu had been found at that time, but that any such compositions found in the future would be an “as-yet-undescribed new member of the adelite group”. Such compositions were later found, leading to the description of a new mineral – arsenodescloizite (Keller and Dunn, 1980) for which Tsumeb is the type locality.
My good friend Paul Carr and I’ve recently run about 250 quantitative analyses of Tsumeb duftites, conichalcites and austinites. The compositions are shown in the accompanying chart. Duftite plots in the bottom left quadrant; conichalcite in the bottom right; austinite in the top right, and (much rarer) arsenodescloizite in the top left quadrant. As you can see, a very wide range of compositions are present.
While it's usually possible to identify austinite by visual means, the distinction between conichalcite and duftite is much more difficult. I’ve learned that in the absence of an analysis, it’s much safer to label these things as “duftite / conichalcite series”.
Malcolm Southwood.
References:
Burke, E. A. J. (2006). A mass discreditation of GQN minerals. The Canadian Mineralogist, 44, 1557–1560.
Guillemin, C. (1956). Contribution a la minéralogie des arséniates, phosphates, et vanadates de cuivre. Bulletin de la Société Français Minéralogie et de Cristallographie, 79, 7-95.
Jambor, J.L., Owens, D.R. and Dutrizac, J.E. (1980). Solid solution in the adelite group of arsenates. The Canadian Mineralogist, 18, 191-195.
Kharisun, Taylor, M. R., Bevan, D. J. M. and Pring, A. (1998). The crystal chemistry of duftite, PbCuAsO4(OH) and the beta-duftite problem. Mineralogical Magazine, 62, 121-130. References: |
| ⓘ 'Duftite-alpha' Formula: PbCu(AsO4)(OH) Habit: Distorted crystals with irregular faces. Crystals to 3mm. Colour: Olive to gray-green and dark green Description: Darker and more rare than duftite-beta.
Guillemin (1956) proposed that compositions close to end member duftite – PbCu(AsO4)(OH) – are isostructural with descloizite. He called duftites of this composition α-duftite and found that it could readily be synthesisd in the laboratory. However, he also found that certain duftites with more than about 20% substitution of calcium for lead were isomorphous with conichalcite and could not be synthesised. He proposed the name β-duftite for these compositions and suggested that β-duftite forms a series with conichalcite.
The distinction between these two “polymorphs” was quite important at Tsumeb in the 1970s and 1980s, because they accounted for a significant proportion of the lead (and to a smaller extent copper) in certain ore types but responded quite differently to the flotation process in the concentrator. Because of this, former Tsumeb Corporation mineralogist John Innes encouraged various technical and academic studies of these minerals. The “duftite problem” has been discussed by several authors, but the most relevant to a simple explanation are as follows:
Jambor et al. (1980) examined a series of calcian duftite and plumbian conichalcite specimens from Tsumeb and concluded that complete solid solution probably exists between the duftite and conichalcite and they proposed that β-duftite is merely an intermediate in the duftite-conichalcite series (as opposed to a distinct polymorph).
Kharisun et al. (1998) studied the structure of duftite, conichalcite and of intermediate compositions. They agreed with Jambor et al. (1980) that “β-duftite” is not a distinct mineral but rather a composition, or series of compositions within the duftite-conichalcite series. However, the relationship is not one of simple solid solution; instead, modulated structures comprising domains of different composition occur. This explains why Guillemin (1956) had been unable to synthesise his beta polymorph, but it also indicates that “β-duftite” is not a valid mineral!
Burke (2006) included “duftite-beta” among minerals officially discredited by the IMA.
So much for “β-duftite”, but its interesting (to us Tsumeb geeks anyway) that Jambor et al. (1980) also demonstrated extensive solid solution between conichalcite and austinite. They noted, though, that no compositions with both Pb>Ca and Zn>Cu had been found at that time, but that any such compositions found in the future would be an “as-yet-undescribed new member of the adelite group”. Such compositions were later found, leading to the description of a new mineral – arsenodescloizite (Keller and Dunn, 1980) for which Tsumeb is the type locality.
My good friend Paul Carr and I’ve recently run about 250 quantitative analyses of Tsumeb duftites, conichalcites and austinites. The compositions are shown in the accompanying chart. Duftite plots in the bottom left quadrant; conichalcite in the bottom right; austinite in the top right, and (much rarer) arsenodescloizite in the top left quadrant. As you can see, a very wide range of compositions are present.
While it's usually possible to identify austinite by visual means, the distinction between conichalcite and duftite is much more difficult. I’ve learned that in the absence of an analysis it’s much safer to label these things as “duftite / conichalcite series”.
Malcolm Southwood.
References:
Burke, E. A. J. (2006). A mass discreditation of GQN minerals. The Canadian Mineralogist, 44, 1557–1560.
Guillemin, C. (1956). Contribution a la minéralogie des arséniates, phosphates, et vanadates de cuivre. Bulletin de la Société Français Minéralogie et de Cristallographie, 79, 7-95
Jambor, J.L., Owens, D.R. and Dutrizac, J.E. (1980). Solid solution in the adelite group of arsenates. The Canadian Mineralogist, 18, 191-195
Kharisun, Taylor, M. R., Bevan, D. J. M. and Pring, A. (1998). The crystal chemistry of duftite, PbCuAsO4(OH) and the beta-duftite problem. Mineralogical Magazine, 62, 121-130 |
| ⓘ Dundasite Formula: PbAl2(CO3)2(OH)4 · H2O |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Dzhalindite Formula: In(OH)3 References: |
| ⓘ Edwardsite Formula: Cu3Cd2(SO4)2(OH)6 · 4H2O References: |
| ⓘ Ekatite (TL) Formula: (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 Type Locality: |
| ⓘ Elyite Formula: Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ Enargite Formula: Cu3AsS4 References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erikapohlite (TL) Formula: Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O Type Locality: References: |
| ⓘ Euchroite Formula: Cu2(AsO4)(OH) · 3H2O |
| ⓘ Eugenite Formula: Ag11Hg2 References: |
| ⓘ Eyselite (TL) Formula: Fe3+Ge4+3O7(OH) Type Locality: |
| ⓘ Fahleite (TL) Formula: CaZn5Fe3+2(AsO4)6 · 14H2O Type Locality: |
| ⓘ Famatinite Formula: Cu3SbS4 |
| ⓘ Feinglosite (TL) Formula: Pb2Zn(AsO4)2 · H2O Type Locality: |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrilotharmeyerite (TL) Formula: CaZnFe3+(AsO4)2(OH) · H2O Type Locality: Description: 32 level, W40 stope. |
| ⓘ Fleischerite (TL) Formula: Pb3Ge(SO4)2(OH)6 · 3H2O Type Locality: Description: Level 6-8. |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Description: Rare but widespread, although sparsely, as an accessory (detrital) mineral in the feldspathic sandstone bodies in the Tsumeb pipe, derrived from the overlying Tschudi Formation.
|
| ⓘ Fluorite Formula: CaF2 Description: In 1996 found as tiny 2mm crystals from the third oxidation zone, colourless and associated with calcite (Gebhard 1999). |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) Description: Fornacite - With plancheite and dioptase References: |
| ⓘ Fraipontite Formula: (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ Freedite Formula: Cu+Pb8(AsO3)2O3Cl5 |
| ⓘ Furutobeite Formula: (Cu,Ag)6PbS4 |
| ⓘ Gaitite (TL) Formula: Ca2Zn(AsO4)2 · 2H2O Type Locality: |
| ⓘ Galena Formula: PbS References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Gallite (TL) Formula: CuGaS2 Type Locality: Description: Tsumeb and Kipushi are co-type localities for gallite. |
| ⓘ Gallobeudantite (TL) Formula: PbGa3(AsO4)(SO4)(OH)6 Type Locality: |
| ⓘ Galloplumbogummite (TL) Formula: Pb(Ga,Al,Ge)3(PO4)2(OH)6 Type Locality: References: Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011. CNMNC Newsletter No 9. Mineralogical Magazine, 75 (4) 2535-2540 doi:10.1180/minmag.2011.075.4.2535 Schlüter, Jochen, Malcherek, Thomas, Mihailova, Boriana (2014) Galloplumbogummite from Tsumeb, Namibia, a new member of the alunite group with tetravalent charge balance. Neues Jahrbuch für Mineralogie - Abhandlungen Journal of Mineralogy and Geochemistry, 191 (3) 301-309 doi:10.1127/0077-7757/2014/0262 |
| ⓘ Gartrellite Formula: PbCuFe3+(AsO4)2(OH) · H2O |
| ✪ Gebhardite (TL) Formula: Pb8(As2O5)2OCl6 Type Locality: |
| ⓘ Geminite Formula: Cu2+(AsO3OH) · H2O References: Hawthorne, Frank C., Cooper, Mark A., Abdu, Yassir A., Ball, Neil A., Back, Malcolm E., Tait, Kim T. (2012) Davidlloydite, ideally Zn3(AsO4)2(H2O)4, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (1) 45-57 doi:10.1180/minmag.2012.076.1.45 |
| ✪ Gerdtremmelite (TL) Formula: (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 Type Locality: Description: From the 44 level. |
| ⓘ Germanite (TL) Formula: Cu13Fe2Ge2S16 Type Locality: References: |
| ⓘ Germanocolusite Formula: Cu26V2(Ge,As)6S32 Description: Identified as germanite-3, yellow germanite, vanadium or vanadiun-arsenic germanite, vagearsite References: |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gordaite Formula: NaZn4(SO4)(OH)6Cl · 6H2O Description: Mark Feinglos specimen with germanite matrix References: |
| ⓘ Graphite Formula: C |
| ⓘ Gratonite Formula: Pb9As4S15 |
| ⓘ Greenockite Formula: CdS |
| ⓘ Gunningite Formula: ZnSO4 · H2O References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Halilsarpite Formula: [Mg(H2O)6][CaAs3+2(Fe3+2.67Mo6+0.33)(AsO4)2O7] References: Desor, J. (01/2025) SEM-EDS & SCXRDIdentified by Joy Desor: XRD, SEM-EDS |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ✪ Helmutwinklerite (TL) Formula: PbZn2(AsO4)2 · 2H2O Type Locality: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Kidney Ore Formula: Fe2O3 Description: Botryoidal hemantite was found on large mimetite crystal, partially pseudomorphosing them.
According to Gebhard, the pocket was found on level 46. |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hermannroseite (TL) Formula: CaCu(PO4)(OH) Type Locality: |
| ⓘ Heterogenite Formula: Co3+O(OH) Description: Many specimens labeled as being heterogenite from Tsumeb, are in fact misidentified goethite specimens. |
| ⓘ Hidalgoite Formula: PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ Hinsdalite Formula: PbAl3(PO4)(SO4)(OH)6 References: |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydrocerussite Formula: Pb3(CO3)2(OH)2 |
| ⓘ Hydroxylapatite Formula: Ca5(PO4)3(OH) |
| ⓘ Hydroxylpyromorphite Formula: Pb5(PO4)3(OH) References: |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Ianbruceite (TL) Formula: Zn2(AsO4)(OH) · 3H2O Localities: |
| ⓘ Idaite ? Formula: Cu5FeS6 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Iodargyrite Formula: AgI References: |
| ⓘ Itoite (TL) Formula: Pb3Ge4+(SO4)2O2(OH)2 Type Locality: |
| ✪ Jamesite (TL) Formula: Pb2Zn(Fe2+,Zn)2Fe3+4(AsO4)4(OH)10 Type Locality: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 Habit: fine needles with tennantite and iron stained carbonate Colour: metallic gray black Fluorescence: none Description: Known as a single specimen, ex RWMW collection, now on display at the Royal Ontario Museum in Toronto. References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Jeanbandyite Formula: Fe3+xFe2+1-xSn(OH)6-xOx References: |
| ⓘ Johillerite (TL) Formula: Na(Mg,Zn)3Cu(AsO4)3 Type Locality: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Karibibite Formula: Fe3+3(As3+O2)4(As3+2O5)(OH) Description: Occurs as pale yellow intertwined fibres on a sample containing leiteite and schneiderhöhnite. |
| ⓘ Karlseifertite (TL) Formula: Pb(Ga2Ge)(AsO4)2(OH)6 Type Locality: References: |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ✪ Kegelite (TL) Formula: Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 Type Locality: References: |
| ⓘ Kësterite Formula: Cu2ZnSnS4 References: |
| ✪ Keyite (TL) Formula: Cu2+3Zn4Cd2(AsO4)6 · 2H2O Type Locality: |
| ⓘ Kintoreite Formula: PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ 'Kintoreite-Segnitite Series' |
| ⓘ Koritnigite (TL) Formula: Zn(AsO3OH) · H2O Type Locality: Description: Level 31, pillar E9. |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Krieselite (TL) Formula: Al2(GeO4)F2 Type Locality: |
| ⓘ Ktenasite Formula: ZnCu4(SO4)2(OH)6 · 6H2O References: |
| ⓘ Lammerite Formula: Cu3(AsO4)2 |
| ⓘ Lanarkite Formula: Pb2(SO4)O Description: associated with leadhillite, hydrocerussite on bornite, chalcocite & galena matrix. References: |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Larsenite Formula: PbZnSiO4 |
| ⓘ Lauraniite Formula: Cu6Cd2(SO4)2(OH)12 · 5H2O References: |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ Lavendulan var. Zinclavendulan (FRL) Formula: NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O Type Locality: |
| ⓘ Lazaridisite Formula: 3CdSO4 · 8H2O References: |
| ✪ Leadhillite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Legrandite Formula: Zn2(AsO4)(OH) · H2O |
| ⓘ Leightonite Formula: K2Ca2Cu(SO4)4 · 2H2O |
| ✪ Leiteite (TL) Formula: Zn(As2O4) Type Locality: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Libethenite Formula: Cu2(PO4)(OH) References: |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Lindackerite Formula: CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ Linnaeite Formula: Co2+Co3+2S4 |
| ✪ Ludlockite (TL) Formula: PbFe3+4As3+10O22 Type Locality: Habit: Fibrous Colour: Reddish Description: May be confused with karibibite. |
| ⓘ Lukrahnite (TL) Formula: CaCuFe3+(AsO4)2(OH,H2O)2 Type Locality: References: |
| ⓘ Luzonite Formula: Cu3AsS4 |
| ⓘ Macphersonite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Maghemite Formula: (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Maikainite Formula: Cu20(Fe,Cu)6Mo2Ge6S32 |
| ✪ Malachite Formula: Cu2(CO3)(OH)2 Habit: Frequently as pseudomorphous replacement or partial replacement of azurite crystals, but "primary" malachite is also known. References: |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Massicot Formula: PbO |
| ⓘ Mathewrogersite (TL) Formula: Pb7FeAl3GeSi12O36(OH,H2O)6 Type Locality: |
| ⓘ Matlockite Formula: PbFCl |
| ⓘ Mawbyite Formula: PbFe3+2(AsO4)2(OH)2 References: |
| ⓘ Mawsonite Formula: Cu6Fe2SnS8 Description: small inclusions in bornite and tennantite. |
| ⓘ Mckinstryite Formula: Ag5-xCu3+xS4 Description: The mineral is associated with an unknown Ag-Hg phase (most likely eugenite), that is under investigation. The identification by SXRD cannot be made, as the phase is very small. A Raman reference of a SXRD microdiffraction confirmed Mckinstryite crystal from the Clara mine, Germany has been used as a reference for the confirmation from Tsumeb. The standardless SEM-EDS data is very consistent with the McKinstryite from the Clara mine and in general with Mckinstryite. References: |
| ✪ Melanotekite Formula: Pb2Fe3+2(Si2O7)O2 |
| ⓘ Mendipite Formula: Pb3Cl2O2 |
| ⓘ Metacinnabar Formula: HgS |
| ⓘ Metazeunerite Formula: Cu(UO2)2(AsO4)2 · 8H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Millerite Formula: NiS |
| ✪ Mimetite Formula: Pb5(AsO4)3Cl Habit: usually prismatic Colour: mainly colorless to yellowish or brownish Description: world class samples (extraordinary crystals, according to the "handbook of mineralogy") References: |
| ⓘ 'Mineral GS1 (of Gebhard)' Formula: Zn, Fe, As, O, H |
| ⓘ Minium Formula: Pb3O4 |
| ✪ Minrecordite (TL) Formula: CaZn(CO3)2 Type Locality: |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdofornacite (TL) Formula: Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) Type Locality: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) References: |
| ⓘ Montmorillonite Formula: (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ Mottramite Formula: PbCu(VO4)(OH) |
| ⓘ Munakataite Formula: Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nadorite Formula: PbSbClO2 Habit: Eight sided or square tabular crystals Colour: Beige Description: Associated with a beudantite-group mineral and chalcoite. |
| ⓘ Namuwite Formula: Zn4(SO4)(OH)6 · 4H2O Colour: sea green Description: Tiny crystals in cavities in galena. |
| ⓘ Nancyrossite (TL) Formula: FeGeO6H5 Type Locality: Description: level 30 |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au Description: Produced as a by-product - http://www.mme.gov.na/gsn/pdf/gold.pdf |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Naumannite Formula: Ag2Se References: |
| ⓘ Niedermayrite Formula: CdCu4(SO4)2(OH)6 · 4H2O References: |
| ⓘ O'Danielite (TL) Formula: Na(Zn,Mg)3(AsO4)(AsO3OH)2 Type Locality: References: |
| ⓘ Ojuelaite Formula: ZnFe3+2(AsO4)2(OH)2 · 4H2O |
| ✪ Olivenite Formula: Cu2(AsO4)(OH) Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. |
| ⓘ Olivenite var. Zinc-bearing Olivenite Formula: (Cu,Zn)2(AsO4)(OH) |
| ⓘ Olsacherite Formula: Pb2(Se6+O4)(SO4) References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ✪ Otavite (TL) Formula: CdCO3 Type Locality: |
| ✪ Otjisumeite (TL) Formula: PbGe4O9 Type Locality: |
| ✪ Ovamboite (TL) Formula: Cu20(Fe,Cu,Zn)6W2Ge6S32 Type Locality: |
| ⓘ Oxyplumboroméite Formula: Pb2Sb2O6O |
| ⓘ Palygorskite Formula: ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ✪ Paradamite Formula: Zn2(AsO4)(OH) Description: Paradamite has been found at this location as creamy-white lozenge shaped crystals and as lemon-yellow sheaf like aggregates up to 1 cm. |
| ⓘ Parkinsonite Formula: Pb7MoO9Cl2 |
| ⓘ Parnauite Formula: Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ Patrónite ? Formula: VS4 |
| ⓘ Perroudite Formula: Hg5Ag4S5(I,Br)2Cl2 References: Keller, Paul, Lissner, Falk, Schleid, Thomas (2005) Single-crystal structure determination of perroudite, Hg5Ag4S5(I, Br)2Cl2, from Tsumeb (Namibia), and its structural relationships to other sulfide halides of mercury and cinnabar. Neues Jahrbuch für Mineralogie - Abhandlungen, 181 (1) 1-9 doi:10.1127/0077-7757/2005/0181-0004 |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Philipsbornite Formula: PbAl3(AsO4)(AsO3OH)(OH)6 References: |
| ⓘ Philipsburgite Formula: Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 |
| ⓘ Plancheite Formula: Cu8(Si8O22)(OH)4 · H2O |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbogummite var. Ga-rich plumbogummite Formula: Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| ⓘ Plumbojarosite Formula: Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ Plumboselite (TL) Formula: Pb3O2(SeO3) Type Locality: |
| ⓘ Plumbotsumite (TL) Formula: Pb13(CO3)6(Si10O27) · 3H2O Type Locality: |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Prosopite Formula: CaAl2F4[(OH)4-xFx] |
| ⓘ Prosperite (TL) Formula: Ca2Zn4(AsO4)4 · H2O Type Locality: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 Habit: Crystals to 1cm, massive Colour: Milky, gray Description: In veins and country rock. References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ✪ Queitite (TL) Formula: Pb4Zn2(SO4)(SiO4)(Si2O7) Type Locality: References: |
| ⓘ Realgar Formula: As4S4 Description: Found as inclusions. |
| ✪ Reinerite (TL) Formula: Zn3(AsO3)2 Type Locality: Description: 23.4 |
| ⓘ Renierite Formula: (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ Rhodochrosite Formula: MnCO3 Description: Analysis here https://www.mindat.org/photo-892883.html on Jordi Fabre's specimen photo https://www.mindat.org/photo-313243.html proves rhodochrosite and not to be confused with smithsonite. |
| ⓘ Richardsite ? Formula: Zn2CuGaS4 Description: needs more precise high resolution chemical data. Area where richardsite was found is an exsolution. References: |
| ⓘ Romanèchite Formula: (Ba,H2O)2(Mn4+,Mn3+)5O10 References: |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 References: |
| ⓘ Roxbyite Formula: Cu58S32 |
| ⓘ Rutile Formula: TiO2 |
| ✪ Schaurteite (TL) Formula: Ca3Ge(SO4)2(OH)6 · 4H2O Type Locality: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ✪ Schneiderhöhnite (TL) Formula: Fe2+Fe3+3As3+5O13 Type Locality: |
| ⓘ Schulenbergite Formula: (Cu,Zn)7(SO4)2(OH)10 · 3H2O References: |
| ✪ Schultenite (TL) Formula: Pb(HAsO4) Type Locality: |
| ✪ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Scotlandite Formula: PbSO3 Habit: Prismatic Colour: Yellow Description: Found on a specimen of hydrocerussite from the Lead Pocket, 1991, 43 level. |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Seligmannite Formula: PbCuAsS3 |
| ⓘ Senarmontite Formula: Sb2O3 References: |
| ⓘ Serpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ Sewardite (TL) Formula: CaFe3+2(AsO4)2(OH)2 Type Locality: Description: occurs as platy to compact anhedral to subhedral masses that do not exceed 0.3 mm in maximum size and are randomly scattered throughout the dark green to black matrix. Sewardite is easily confused with the more common carminite; chemical analysis is required to distinguish the two minerals |
| ⓘ Shattuckite Formula: Cu5(Si2O6)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Siderite var. Zinc-bearing Siderite Formula: (Fe,Zn)CO3 References: |
| ✪ Sidpietersite (TL) Formula: Pb2+4(S2O3)O2(OH)2 Type Locality: Description: |
| ⓘ Skorpionite Formula: Ca3Zn2(PO4)2(CO3)(OH)2 · H2O Colour: white Description: Found as white needles to 0.5mm on colourless smithsonite associated with willemite on sphalerite-galena-dolomite-tennantite matrix level 33, stope W80. |
| ✪ Smithsonite Formula: ZnCO3 References: |
| ✪ Söhngeite (TL) Formula: Ga(OH)3 Type Locality: |
| ⓘ Spertiniite Formula: Cu(OH)2 |
| ⓘ Sphalerite Formula: ZnS References: Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203 Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stibioclaudetite (TL) Formula: AsSbO3 Type Locality: |
| ⓘ Stibnite ? Formula: Sb2S3 Description: See https://www.mindat.org/mesg-513605.html
|
| ✪ Stolzite Formula: Pb(WO4) Colour: light yellow |
| ✪ Stottite (TL) Formula: Fe2+[Ge4+(OH)6] Type Locality: Description: Level 30 = 1000m. |
| ✪ Stranskiite (TL) Formula: Zn2Cu(AsO4)2 Type Locality: |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ Sulvanite Formula: Cu3VS4 |
| ⓘ Surite Formula: (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 Description: Subhedral highly viterous, glassy crystals found on Level34, W30 stope, Level 28, W30 stope, Level 39, W30 stope and Level 29, W30 stope known associations are smithsonite, willemite, kegelite, queitite, eyite, goethite, sphalerite, galena, tennantite, calcite, dolomite and kaolinite. |
| ⓘ Susannite Formula: Pb4(CO3)2(SO4)(OH)2 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Talmessite Formula: Ca2Mg(AsO4)2 · 2H2O References: |
| ⓘ Tangeite Formula: CaCu(VO4)(OH) |
| ⓘ Tennantite-(Cu) Formula: Cu6(Cu4Cu2)As4S12S References: |
| ✪ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S Habit: Tetrahedral crystals to 30cm on edge. Colour: Mostly frosted or corroded Description: Pseudomorphs of azurite and malachite after tennantite are found. References: Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247 |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S References: |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'Tetrahedrite Subgroup' ? Formula: Cu6(Cu4C2+2)Sb4S12S Description: Antimony appears to be scarce and not positively identified. May be included due to mistranslation of fahlerz. |
| ⓘ Thaumasite Formula: Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ✪ Thometzekite (TL) Formula: PbCu2+2(AsO4)2 · 2H2O Type Locality: |
| ⓘ Tilasite Formula: CaMg(AsO4)F Colour: White |
| ⓘ Titanite Formula: CaTi(SiO4)O Description: Listed in the species list only, as massive and common (page 317). |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ✪ Tsumcorite (TL) Formula: PbZn2(AsO4)2 · 2H2O Type Locality: Habit: Crystals Colour: brown |
| ⓘ Tsumebite (TL) Formula: Pb2Cu(PO4)(SO4)(OH) Type Locality: References: |
| ⓘ Tsumgallite (TL) Formula: GaO(OH) Type Locality: |
| ⓘ Tungstenite Formula: WS2 |
| ⓘ Umangite Formula: Cu3Se2 |
| ✪ Vanackerite (TL) Formula: Pb4Cd(AsO4)3Cl Type Locality: |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl References: |
| ⓘ Vésigniéite Formula: BaCu3(VO4)2(OH)2 |
| ✪ Warikahnite (TL) Formula: Zn3(AsO4)2 · 2H2O Type Locality: Description: 2nd oxidation zone (Pilar E9, 31st level). References: |
| ⓘ Whitlockite Formula: Ca9Mg(PO4)6(PO3OH) |
| ⓘ Wilhelmkleinite (TL) Formula: ZnFe3+2(AsO4)2(OH)2 Type Locality: Description: From the 44 level. References: |
| ✪ Willemite Formula: Zn2SiO4 |
| ⓘ Witherite Formula: BaCO3 Habit: Minute flat pseudohexagonal crystals, massive Colour: mily gray to white or cream colored |
| ⓘ Wroewolfeite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ✪ Wulfenite Formula: Pb(MoO4) References: |
| ⓘ Wulfenite var. Chillagite Formula: Pb[(Mo,W)O4] |
| ⓘ Wurtzite Formula: (Zn,Fe)S |
| ⓘ Yancowinnaite Formula: PbCuAl(AsO4)2OH · H2O Colour: yellow green Description: EDS: Pb1(Cu^2+_1.07,Zn_0.08,Al3+_0.69,Fe3+_0.20)(AsO4)_1.9(PO4)0.1(OH)_0.85(H_2O)1.15
|
| ⓘ Yvonite Formula: Cu(HAsO4) · 2H2O |
| ⓘ Zharchikhite Formula: AlF(OH)2 |
| ⓘ Zincgartrellite (TL) Formula: PbZn2(AsO4)2(H2O,OH)2 Type Locality: |
| ⓘ Zincobriartite Formula: Cu2(Zn,Fe)(Ge,Ga)S4 |
| ✪ Zincolivenite Formula: CuZn(AsO4)(OH) Description: https://youtu.be/3qgo9po-bT8 A very interesting presentation on the Adamite-Zincolvinite-Olivenite series. |
| ⓘ Zincostottite (TL) Formula: ZnGe(OH)6 Type Locality: |
| ⓘ Zincrosasite (TL) Formula: (Zn,Cu)2(CO3)(OH)2 Type Locality: |
| ✪ Zincroselite (TL) Formula: Ca2Zn(AsO4)2 · 2H2O Type Locality: Colour: white to colorless References: |
| ⓘ Zircon Formula: Zr(SiO4) Description: A mineral from the country rock. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Eugenite | 1.AD.15c | Ag11Hg2 |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Roxbyite | 2.BA.05 | Cu58S32 |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Berzelianite | 2.BA.20 | Cu2-xSe (x ≈ 0.12) |
| ⓘ | Umangite | 2.BA.25 | Cu3Se2 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Mckinstryite | 2.BA.40 | Ag5-xCu3+xS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Naumannite | 2.BA.55 | Ag2Se |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Betekhtinite | 2.BE.05 | Pb2(Cu,Fe)22-24S15 |
| ⓘ | Furutobeite | 2.BE.10 | (Cu,Ag)6PbS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Calvertite (TL) | 2.CA.15 | Cu5Ge0.5S4 |
| ⓘ | Richardsite ? | 2.CB. | Zn2CuGaS4 |
| ⓘ | Metacinnabar | 2.CB.05a | HgS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Gallite (TL) | 2.CB.10a | CuGaS2 |
| ⓘ | Idaite ? | 2.CB.15a | Cu5FeS6 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Mawsonite | 2.CB.20 | Cu6Fe2SnS8 |
| ⓘ | Colusite | 2.CB.30 | Cu13VAs3S16 |
| ⓘ | Germanite (TL) | 2.CB.30 | Cu13Fe2Ge2S16 |
| ⓘ | Germanocolusite | 2.CB.30 | Cu26V2(Ge,As)6S32 |
| ⓘ | Ovamboite (TL) | 2.CB.30 | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| ⓘ | Maikainite | 2.CB.30 | Cu20(Fe,Cu)6Mo2Ge6S32 |
| ⓘ | Renierite | 2.CB.35a | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| ⓘ | Greenockite | 2.CB.45 | CdS |
| ⓘ | Wurtzite | 2.CB.45 | (Zn,Fe)S |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Sulvanite | 2.CB.70 | Cu3VS4 |
| ⓘ | Millerite | 2.CC.20 | NiS |
| ⓘ | Clausthalite | 2.CD.10 | PbSe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Carrollite | 2.DA.05 | CuCo2S4 |
| ⓘ | Linnaeite | 2.DA.05 | Co2+Co3+2S4 |
| ⓘ | Stibnite ? | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Patrónite ? | 2.EC.10 | VS4 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Perroudite | 2.FC.20c | Hg5Ag4S5(I,Br)2Cl2 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Seligmannite | 2.GA.50 | PbCuAsS3 |
| ⓘ | Tennantite-(Cu) | 2.GB. | Cu6(Cu4Cu2)As4S12S |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' ? | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Cupropearceite | 2.GB.15 | [Cu6As2S7][Ag9CuS4] |
| ⓘ | Cupropolybasite | 2.GB.15 | [Cu6Sb2S7][Ag9CuS4] |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Gratonite | 2.JB.55 | Pb9As4S15 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| ⓘ | Briartite | 2.KA.10 | Cu2FeGeS4 |
| ⓘ | Famatinite | 2.KA.10 | Cu3SbS4 |
| ⓘ | Luzonite | 2.KA.10 | Cu3AsS4 |
| ⓘ | Zincobriartite | 2.KA.10 | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Zharchikhite | 3.AC.05 | AlF(OH)2 |
| ⓘ | Prosopite | 3.CD.10 | CaAl2F4[(OH)4-xFx] |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| ⓘ | Parkinsonite | 3.DB.40 | Pb7MoO9Cl2 |
| ⓘ | Matlockite | 3.DC.25 | PbFCl |
| ⓘ | Nadorite | 3.DC.30 | PbSbClO2 |
| ⓘ | Mendipite | 3.DC.70 | Pb3Cl2O2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite var. Chalcotrichite | 4.AA.10 | Cu2O |
| ⓘ | 4.AA.10 | Cu2O | |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Massicot | 4.AC.25 | PbO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Maghemite | 4.BB.15 | (Fe3+0.67◻0.33)Fe3+2O4 |
| ⓘ | Minium | 4.BD.05 | Pb3O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Kidney Ore | 4.CB.05 | Fe2O3 |
| ⓘ | Claudetite | 4.CB.45 | As2O3 |
| ⓘ | Stibioclaudetite (TL) | 4.CB.45 | AsSbO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Argutite | 4.DB.05 | GeO2 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Biehlite (TL) | 4.DB.60 | ((Sb,As)O)2[MoO4] |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Oxyplumboroméite | 4.DH. | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Romanèchite | 4.DK.10 | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| ⓘ | Eyselite (TL) | 4.DM.20 | Fe3+Ge4+3O7(OH) |
| ⓘ | Ashoverite | 4.FA.10 | Zn(OH)2 |
| ⓘ | Dzhalindite | 4.FC.05 | In(OH)3 |
| ⓘ | Söhngeite (TL) | 4.FC.05 | Ga(OH)3 |
| ⓘ | Jeanbandyite | 4.FC.15 | Fe3+xFe2+1-xSn(OH)6-xOx |
| ⓘ | Stottite (TL) | 4.FC.15 | Fe2+[Ge4+(OH)6] |
| ⓘ | Nancyrossite (TL) | 4.FC.15 | FeGeO6H5 |
| ⓘ | Zincostottite (TL) | 4.FC.15 | ZnGe(OH)6 |
| ⓘ | Spertiniite | 4.FD.05 | Cu(OH)2 |
| ⓘ | Tsumgallite (TL) | 4.FD.10 | GaO(OH) |
| ⓘ | Brucite | 4.FE.05 | Mg(OH)2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| ⓘ | Heterogenite | 4.FE.20 | Co3+O(OH) |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Leiteite (TL) | 4.JA.05 | Zn(As2O4) |
| ⓘ | Reinerite (TL) | 4.JA.10 | Zn3(AsO3)2 |
| ⓘ | Karibibite | 4.JA.15 | Fe3+3(As3+O2)4(As3+2O5)(OH) |
| ⓘ | Schneiderhöhnite (TL) | 4.JA.35 | Fe2+Fe3+3As3+5O13 |
| ⓘ | Ludlockite (TL) | 4.JA.45 | PbFe3+4As3+10O22 |
| ⓘ | Gebhardite (TL) | 4.JB.50 | Pb8(As2O5)2OCl6 |
| ⓘ | Freedite | 4.JB.65 | Cu+Pb8(AsO3)2O3Cl5 |
| ⓘ | Ekatite (TL) | 4.JB.75 | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| ⓘ | Scotlandite | 4.JE.20 | PbSO3 |
| ⓘ | Plumboselite (TL) | 4.JG.50 | Pb3O2(SeO3) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Otavite (TL) | 5.AB.05 | CdCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite var. Zinc-bearing Siderite | 5.AB.05 | (Fe,Zn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite var. Cobalt-bearing Dolomite | 5.AB.10 | (Ca,Mg,Co)CO3 |
| ⓘ | 5.AB.10 | CaMg(CO3)2 | |
| ⓘ | Minrecordite (TL) | 5.AB.10 | CaZn(CO3)2 |
| ⓘ | Dolomite var. Zinc-bearing Dolomite | 5.AB.10 | Ca(Mg,Zn)(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Aragonite var. Lead-bearing Aragonite | 5.AB.15 | (Ca,Pb)CO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Aragonite var. Zinc-bearing Aragonite | 5.AB.15 | (Ca,Zn)CO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Zincrosasite (TL) | 5.BA.10 | (Zn,Cu)2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Hydrocerussite | 5.BE.10 | Pb3(CO3)2(OH)2 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| ⓘ | Abellaite | 5.BE.X | NaPb2(CO3)2(OH) |
| ⓘ | Brianyoungite | 5.BF.30 | Zn3(CO3,SO4)(OH)4 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Macphersonite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Susannite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| ⓘ | Chalconatronite | 5.CB.40 | Na2Cu(CO3)2 · 3H2O |
| ⓘ | Dundasite | 5.DB.10 | PbAl2(CO3)2(OH)4 · H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Celestine | 7.AD.35 | SrSO4 |
| ⓘ | Olsacherite | 7.AD.35 | Pb2(Se6+O4)(SO4) |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Beaverite-(Cu) | 7.BC.10 | Pb(Fe3+2Cu)(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Plumbojarosite | 7.BC.10 | Pb0.5Fe3+3(SO4)2(OH)6 |
| ⓘ | Karlseifertite (TL) | 7.BC.10 | Pb(Ga2Ge)(AsO4)2(OH)6 |
| ⓘ | Caledonite | 7.BC.50 | Pb5Cu2(SO4)3(CO3)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Munakataite | 7.BC.65 | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| ⓘ | Cadsulfohite (TL) | 7.BD. | Cd2(SO4)(OH)2 |
| ⓘ | Lanarkite | 7.BD.40 | Pb2(SO4)O |
| ⓘ | Itoite (TL) | 7.BD.50 | Pb3Ge4+(SO4)2O2(OH)2 |
| ⓘ | Gunningite | 7.CB.05 | ZnSO4 · H2O |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Lazaridisite | 7.CB.50 | 3CdSO4 · 8H2O |
| ⓘ | Leightonite | 7.CC.70 | K2Ca2Cu(SO4)4 · 2H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Wroewolfeite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Ktenasite | 7.DD.20 | ZnCu4(SO4)2(OH)6 · 6H2O |
| ⓘ | Devilline | 7.DD.30 | CaCu4(SO4)2(OH)6 · 3H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Serpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Niedermayrite | 7.DD.30 | CdCu4(SO4)2(OH)6 · 4H2O |
| ⓘ | Edwardsite | 7.DD.30 | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| ⓘ | Namuwite | 7.DD.50 | Zn4(SO4)(OH)6 · 4H2O |
| ⓘ | Lauraniite | 7.DD.52 | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| ⓘ | Schulenbergite | 7.DD.80 | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| ⓘ | Fleischerite (TL) | 7.DF.25 | Pb3Ge(SO4)2(OH)6 · 3H2O |
| ⓘ | Schaurteite (TL) | 7.DF.25 | Ca3Ge(SO4)2(OH)6 · 4H2O |
| ⓘ | Gordaite | 7.DF.50 | NaZn4(SO4)(OH)6Cl · 6H2O |
| ⓘ | Elyite | 7.DF.65 | Pb4Cu(SO4)O2(OH)4 · H2O |
| ⓘ | Thaumasite | 7.DG.15 | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Molybdofornacite (TL) | 7.FC.10 | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Stolzite | 7.GA.05 | Pb(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | var. Chillagite | 7.GA.05 | Pb[(Mo,W)O4] |
| ⓘ | Sidpietersite (TL) | 7.JA.05 | Pb2+4(S2O3)O2(OH)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lammerite | 8.AB.30 | Cu3(AsO4)2 |
| ⓘ | Stranskiite (TL) | 8.AB.35 | Zn2Cu(AsO4)2 |
| ⓘ | O'Danielite (TL) | 8.AC.05 | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| ⓘ | Erikapohlite (TL) | 8.AC.05 | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| ⓘ | Johillerite (TL) | 8.AC.10 | Na(Mg,Zn)3Cu(AsO4)3 |
| ⓘ | Whitlockite | 8.AC.45 | Ca9Mg(PO4)6(PO3OH) |
| ⓘ | Schultenite (TL) | 8.AD.30 | Pb(HAsO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | var. Copper-bearing Adamite ? | 8.BB.30 | (Zn,Cu)2AsO4OH |
| ⓘ | Libethenite | 8.BB.30 | Cu2(PO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | var. Zinc-bearing Olivenite | 8.BB.30 | (Cu,Zn)2(AsO4)(OH) |
| ⓘ | Adamite var. Cobalt-bearing Adamite ? | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Zincolivenite | 8.BB.30 | CuZn(AsO4)(OH) |
| ⓘ | Paradamite | 8.BB.35 | Zn2(AsO4)(OH) |
| ⓘ | Wilhelmkleinite (TL) | 8.BB.40 | ZnFe3+2(AsO4)2(OH)2 |
| ⓘ | Cornwallite | 8.BD.05 | Cu5(AsO4)2(OH)4 |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Clinoclase | 8.BE.20 | Cu3(AsO4)(OH)3 |
| ⓘ | Gerdtremmelite (TL) | 8.BE.40 | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| ⓘ | Arsentsumebite (TL) | 8.BG.05 | Pb2Cu(AsO4)(SO4)(OH) |
| ⓘ | Tsumebite (TL) | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Arsenbrackebuschite (TL) | 8.BG.05 | Pb2Fe3+(AsO4)2(OH) |
| ⓘ | Feinglosite (TL) | 8.BG.05 | Pb2Zn(AsO4)2 · H2O |
| ⓘ | Carminite | 8.BH.30 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Sewardite (TL) | 8.BH.30 | CaFe3+2(AsO4)2(OH)2 |
| ⓘ | Arsendescloizite (TL) | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Austinite | 8.BH.35 | CaZn(AsO4)(OH) |
| ⓘ | Conichalcite | 8.BH.35 | CaCu(AsO4)(OH) |
| ⓘ | Duftite (TL) | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Tangeite | 8.BH.35 | CaCu(VO4)(OH) |
| ⓘ | 'Duftite-alpha' | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Hermannroseite (TL) | 8.BH.35 | CaCu(PO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Vésigniéite | 8.BH.45 | BaCu3(VO4)2(OH)2 |
| ⓘ | Jamesite (TL) | 8.BK.25 | Pb2Zn(Fe2+,Zn)2Fe3+4(AsO4)4(OH)10 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Hidalgoite | 8.BL.05 | PbAl3(AsO4)(SO4)(OH)6 |
| ⓘ | Hinsdalite | 8.BL.05 | PbAl3(PO4)(SO4)(OH)6 |
| ⓘ | Gallobeudantite (TL) | 8.BL.05 | PbGa3(AsO4)(SO4)(OH)6 |
| ⓘ | Arsenogoyazite | 8.BL.10 | SrAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Arsenocrandallite | 8.BL.10 | CaAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Kintoreite | 8.BL.10 | PbFe3(PO4)(PO3OH)(OH)6 |
| ⓘ | Philipsbornite | 8.BL.10 | PbAl3(AsO4)(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Plumbogummite var. Ga-rich plumbogummite | 8.BL.10 | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| ⓘ | Galloplumbogummite (TL) | 8.BL.10 | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Hydroxylapatite | 8.BN.05 | Ca5(PO4)3(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Hydroxylpyromorphite | 8.BN.05 | Pb5(PO4)3(OH) |
| ⓘ | Vanackerite (TL) | 8.BN.05 | Pb4Cd(AsO4)3Cl |
| ⓘ | Davidlloydite (TL) | 8.CA. | Zn3(AsO4)2 · 4H2O |
| ⓘ | Arsenohopeite (TL) | 8.CA.30 | Zn3(AsO4)2 · 4H2O |
| ⓘ | Warikahnite (TL) | 8.CA.35 | Zn3(AsO4)2 · 2H2O |
| ⓘ | Keyite (TL) | 8.CA.50 | Cu2+3Zn4Cd2(AsO4)6 · 2H2O |
| ⓘ | Prosperite (TL) | 8.CA.60 | Ca2Zn4(AsO4)4 · H2O |
| ⓘ | Koritnigite (TL) | 8.CB.20 | Zn(AsO3OH) · H2O |
| ⓘ | Yvonite | 8.CB.25 | Cu(HAsO4) · 2H2O |
| ⓘ | Geminite | 8.CB.30 | Cu2+(AsO3OH) · H2O |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Chudobaite (TL) | 8.CE.05 | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| ⓘ | Lindackerite | 8.CE.30 | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Gaitite (TL) | 8.CG.05 | Ca2Zn(AsO4)2 · 2H2O |
| ⓘ | Anorthoroselite | 8.CG.05 | Ca2Co(AsO4)2 · 2H2O |
| ⓘ | Talmessite | 8.CG.05 | Ca2Mg(AsO4)2 · 2H2O |
| ⓘ | Zincroselite (TL) | 8.CG.10 | Ca2Zn(AsO4)2 · 2H2O |
| ⓘ | Ferrilotharmeyerite (TL) | 8.CG.15 | CaZnFe3+(AsO4)2(OH) · H2O |
| ⓘ | Mawbyite | 8.CG.15 | PbFe3+2(AsO4)2(OH)2 |
| ⓘ | Thometzekite (TL) | 8.CG.15 | PbCu2+2(AsO4)2 · 2H2O |
| ⓘ | Tsumcorite (TL) | 8.CG.15 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Cobalttsumcorite | 8.CG.15 | PbCo2(AsO4)2 · 2H2O |
| ⓘ | Yancowinnaite | 8.CG.15 | PbCuAl(AsO4)2OH · H2O |
| ⓘ | Gartrellite | 8.CG.20 | PbCuFe3+(AsO4)2(OH) · H2O |
| ⓘ | Helmutwinklerite (TL) | 8.CG.20 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Zincgartrellite (TL) | 8.CG.20 | PbZn2(AsO4)2(H2O,OH)2 |
| ⓘ | Lukrahnite (TL) | 8.CG.20 | CaCuFe3+(AsO4)2(OH,H2O)2 |
| ⓘ | Halilsarpite | 8.CH.05 | [Mg(H2O)6][CaAs3+2(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| ⓘ | Fahleite (TL) | 8.CH.55 | CaZn5Fe3+2(AsO4)6 · 14H2O |
| ⓘ | Ianbruceite (TL) | 8.DC. | Zn2(AsO4)(OH) · 3H2O |
| ⓘ | Euchroite | 8.DC.07 | Cu2(AsO4)(OH) · 3H2O |
| ⓘ | Legrandite | 8.DC.10 | Zn2(AsO4)(OH) · H2O |
| ⓘ | Arthurite | 8.DC.15 | CuFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Ojuelaite | 8.DC.15 | ZnFe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Bendadaite | 8.DC.15 | Fe2+Fe3+2(AsO4)2(OH)2 · 4H2O |
| ⓘ | Chenevixite | 8.DD.05 | Cu2Fe3+2(AsO4)2(OH)4 |
| ⓘ | Philipsburgite | 8.DE.35 | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ | Chalcophyllite | 8.DF.30 | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| ⓘ | Parnauite | 8.DF.35 | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | var. Zinclavendulan (TL) | 8.DG.05 | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Andyrobertsite (TL) | 8.DH.50 | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| ⓘ | Calcioandyrobertsite (TL) | 8.DH.50 | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Dufrénite | 8.DK.15 | Ca0.5Fe2+Fe3+5(PO4)4(OH)6 · 2H2O |
| ⓘ | Agardite-(Ce) | 8.DL.15 | CeCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Betpakdalite-CaMg (TL) | 8.DM. | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe3+3O36(OH)] |
| ⓘ | Betpakdalite-CaCa | 8.DM.15 | [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] |
| ⓘ | Skorpionite | 8.DO.45 | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| ⓘ | Metazeunerite | 8.EB.10 | Cu(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Larsenite | 9.AB.10 | PbZnSiO4 |
| ⓘ | Brunogeierite (TL) | 9.AC.15 | Ge4+Fe2+2O4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Krieselite (TL) | 9.AF.20 | Al2(GeO4)F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Melanotekite | 9.BE.80 | Pb2Fe3+2(Si2O7)O2 |
| ⓘ | Queitite (TL) | 9.BF.20 | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Mathewrogersite (TL) | 9.CJ.55 | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| ⓘ | Plancheite | 9.DB.35 | Cu8(Si8O22)(OH)4 · H2O |
| ⓘ | Shattuckite | 9.DB.40 | Cu5(Si2O6)2(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Alamosite | 9.DO.20 | PbSiO3 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Baileychlore | 9.EC.55 | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Surite | 9.EC.75 | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| ⓘ | Kegelite (TL) | 9.EC.80 | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Brindleyite | 9.ED.15 | (Ni,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Fraipontite | 9.ED.15 | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Palygorskite | 9.EE.20 | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Plumbotsumite (TL) | 9.HH.20 | Pb13(CO3)6(Si10O27) · 3H2O |
| ⓘ | Bartelkeite (TL) | 9.J0.10 | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| ⓘ | Otjisumeite (TL) | 9.J0.15 | PbGe4O9 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Carnevallite' | - | Cu3GaS4 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Betpakdalite Group' | - | |
| ⓘ | 'Kintoreite-Segnitite Series' | - | |
| ⓘ | 'Mineral GS1 (of Gebhard)' | - | Zn, Fe, As, O, H |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| H | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Austinite | CaZn(AsO4)(OH) |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Ashoverite | Zn(OH)2 |
| H | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| H | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| H | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brucite | Mg(OH)2 |
| H | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| H | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| H | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Chudobaite | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| H | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| H | ⓘ Dzhalindite | In(OH)3 |
| H | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| H | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| H | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| H | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| H | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| H | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| H | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gunningite | ZnSO4 · H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Heterogenite | Co3+O(OH) |
| H | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| H | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| H | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| H | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| H | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| H | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Libethenite | Cu2(PO4)(OH) |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| H | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| H | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| H | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| H | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| H | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| H | ⓘ Paradamite | Zn2(AsO4)(OH) |
| H | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| H | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| H | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| H | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| H | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| H | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| H | ⓘ Schultenite | Pb(HAsO4) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| H | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| H | ⓘ Söhngeite | Ga(OH)3 |
| H | ⓘ Spertiniite | Cu(OH)2 |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| H | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| H | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| H | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| H | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Tangeite | CaCu(VO4)(OH) |
| H | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| H | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| H | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| H | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Zharchikhite | AlF(OH)2 |
| H | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| H | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| H | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| H | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| H | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| H | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| H | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| H | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| H | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| H | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| H | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| H | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| H | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| H | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| H | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| H | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| H | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| H | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| H | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| H | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| H | ⓘ Tsumgallite | GaO(OH) |
| H | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| H | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| H | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| H | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| H | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| H | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| H | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| H | ⓘ Kintoreite-Segnitite Series | |
| H | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| H | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| H | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| H | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| H | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| H | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| H | ⓘ Lazaridisite | 3CdSO4 · 8H2O |
| H | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| H | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| H | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| H | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| H | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| H | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| H | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| H | ⓘ Nancyrossite | FeGeO6H5 |
| H | ⓘ Zincostottite | ZnGe(OH)6 |
| H | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| C | ⓘ Dolomite var. Cobalt-bearing Dolomite | (Ca,Mg,Co)CO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| C | ⓘ Graphite | C |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Minrecordite | CaZn(CO3)2 |
| C | ⓘ Otavite | CdCO3 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| C | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| C | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| C | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| C | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| C | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| C | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| C | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| O | Oxygen | |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Alamosite | PbSiO3 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Argutite | GeO2 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| O | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Austinite | CaZn(AsO4)(OH) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Ashoverite | Zn(OH)2 |
| O | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| O | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| O | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| O | ⓘ Brucite | Mg(OH)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| O | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Celestine | SrSO4 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| O | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| O | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Chudobaite | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| O | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| O | ⓘ Claudetite | As2O3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Dolomite var. Cobalt-bearing Dolomite | (Ca,Mg,Co)CO3 |
| O | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| O | ⓘ Dzhalindite | In(OH)3 |
| O | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| O | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| O | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| O | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| O | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| O | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| O | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| O | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gunningite | ZnSO4 · H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Heterogenite | Co3+O(OH) |
| O | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| O | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| O | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| O | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| O | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| O | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| O | ⓘ Lammerite | Cu3(AsO4)2 |
| O | ⓘ Lanarkite | Pb2(SO4)O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Larsenite | PbZnSiO4 |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| O | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| O | ⓘ Leiteite | Zn(As2O4) |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Libethenite | Cu2(PO4)(OH) |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| O | ⓘ Ludlockite | PbFe43+As103+O22 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Massicot | PbO |
| O | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| O | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| O | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| O | ⓘ Mendipite | Pb3Cl2O2 |
| O | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Minium | Pb3O4 |
| O | ⓘ Minrecordite | CaZn(CO3)2 |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Nadorite | PbSbClO2 |
| O | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| O | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| O | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Otavite | CdCO3 |
| O | ⓘ Otjisumeite | PbGe4O9 |
| O | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| O | ⓘ Paradamite | Zn2(AsO4)(OH) |
| O | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| O | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| O | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| O | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| O | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| O | ⓘ Reinerite | Zn3(AsO3)2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| O | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| O | ⓘ Schultenite | Pb(HAsO4) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Scotlandite | PbSO3 |
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Söhngeite | Ga(OH)3 |
| O | ⓘ Spertiniite | Cu(OH)2 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Stolzite | Pb(WO4) |
| O | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| O | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| O | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| O | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| O | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| O | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Tangeite | CaCu(VO4)(OH) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| O | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| O | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zharchikhite | AlF(OH)2 |
| O | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| O | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| O | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| O | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| O | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| O | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| O | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| O | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| O | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| O | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| O | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| O | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| O | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| O | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| O | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| O | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| O | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| O | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| O | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| O | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| O | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| O | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| O | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| O | ⓘ Tsumgallite | GaO(OH) |
| O | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| O | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| O | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| O | ⓘ Krieselite | Al2(GeO4)F2 |
| O | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| O | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| O | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| O | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| O | ⓘ Stibioclaudetite | AsSbO3 |
| O | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| O | ⓘ Kintoreite-Segnitite Series | |
| O | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| O | ⓘ Plumboselite | Pb3O2(SeO3) |
| O | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| O | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| O | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| O | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| O | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| O | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| O | ⓘ Lazaridisite | 3CdSO4 · 8H2O |
| O | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| O | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| O | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| O | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| O | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| O | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| O | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| O | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| O | ⓘ Nancyrossite | FeGeO6H5 |
| O | ⓘ Zincostottite | ZnGe(OH)6 |
| O | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Matlockite | PbFCl |
| F | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| F | ⓘ Zharchikhite | AlF(OH)2 |
| F | ⓘ Krieselite | Al2(GeO4)F2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Na | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Na | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Na | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Na | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Brucite | Mg(OH)2 |
| Mg | ⓘ Chudobaite | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite var. Cobalt-bearing Dolomite | (Ca,Mg,Co)CO3 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Mg | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Mg | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Mg | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Mg | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Mg | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Mg | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Al | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Al | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Al | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Al | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Al | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| Al | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Al | ⓘ Zharchikhite | AlF(OH)2 |
| Al | ⓘ Krieselite | Al2(GeO4)F2 |
| Al | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Al | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Si | Silicon | |
| Si | ⓘ Alamosite | PbSiO3 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Si | ⓘ Larsenite | PbZnSiO4 |
| Si | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Si | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Palygorskite | ◻Al2Mg2◻2Si8O20(OH)2(H2O)4 · 4H2O |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Si | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Si | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Si | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| P | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| P | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Libethenite | Cu2(PO4)(OH) |
| P | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| P | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| P | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| P | ⓘ Kintoreite-Segnitite Series | |
| P | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| P | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| S | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| S | ⓘ Briartite | Cu2FeGeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| S | ⓘ Carrollite | CuCo2S4 |
| S | ⓘ Celestine | SrSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Colusite | Cu13VAs3S16 |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Djurleite | Cu31S16 |
| S | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Famatinite | Cu3SbS4 |
| S | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| S | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gallite | CuGaS2 |
| S | ⓘ Germanite | Cu13Fe2Ge2S16 |
| S | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Gratonite | Pb9As4S15 |
| S | ⓘ Greenockite | CdS |
| S | ⓘ Gunningite | ZnSO4 · H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| S | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| S | ⓘ Lanarkite | Pb2(SO4)O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Linnaeite | Co2+Co23+S4 |
| S | ⓘ Luzonite | Cu3AsS4 |
| S | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Mawsonite | Cu6Fe2SnS8 |
| S | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| S | ⓘ Metacinnabar | HgS |
| S | ⓘ Millerite | NiS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| S | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| S | ⓘ Patrónite | VS4 |
| S | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| S | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| S | ⓘ Roxbyite | Cu58S32 |
| S | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| S | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| S | ⓘ Scotlandite | PbSO3 |
| S | ⓘ Seligmannite | PbCuAsS3 |
| S | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Sulvanite | Cu3VS4 |
| S | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Tungstenite | WS2 |
| S | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Wurtzite | (Zn,Fe)S |
| S | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| S | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| S | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| S | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| S | ⓘ Carnevallite | Cu3GaS4 |
| S | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| S | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| S | ⓘ Calvertite | Cu5Ge0.5S4 |
| S | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| S | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| S | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| S | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| S | ⓘ Lazaridisite | 3CdSO4 · 8H2O |
| S | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| S | ⓘ Richardsite | Zn2CuGaS4 |
| S | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| S | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cl | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Matlockite | PbFCl |
| Cl | ⓘ Mendipite | Pb3Cl2O2 |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Nadorite | PbSbClO2 |
| Cl | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Cl | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Cl | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Cl | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| K | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| Ca | ⓘ Austinite | CaZn(AsO4)(OH) |
| Ca | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite var. Cobalt-bearing Dolomite | (Ca,Mg,Co)CO3 |
| Ca | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Ca | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Ca | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Hydroxylapatite | Ca5(PO4)3(OH) |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Ca | ⓘ Minrecordite | CaZn(CO3)2 |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Prosopite | CaAl2F4[(OH)4-xFx] |
| Ca | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| Ca | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| Ca | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Ca | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| Ca | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Ca | ⓘ Thaumasite | Ca3(SO4)[Si(OH)6](CO3) · 12H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Tangeite | CaCu(VO4)(OH) |
| Ca | ⓘ Whitlockite | Ca9Mg(PO4)6(PO3OH) |
| Ca | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| Ca | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| Ca | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Ca | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Ca | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Ca | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| Ca | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| Ca | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| Ca | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Ca | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Ca | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| V | Vanadium | |
| V | ⓘ Colusite | Cu13VAs3S16 |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Patrónite | VS4 |
| V | ⓘ Sulvanite | Cu3VS4 |
| V | ⓘ Tangeite | CaCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| V | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Mn | Manganese | |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Fe | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Fe | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Fe | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Briartite | Cu2FeGeS4 |
| Fe | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Fe | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Dufrénite | Ca0.5Fe2+Fe53+(PO4)4(OH)6 · 2H2O |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Fe | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Fe | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| Fe | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| Fe | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Ludlockite | PbFe43+As103+O22 |
| Fe | ⓘ Maghemite | (Fe3+0.67◻0.33)Fe23+O4 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Fe | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Fe | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Fe | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Fe | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| Fe | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Fe | ⓘ Wurtzite | (Zn,Fe)S |
| Fe | ⓘ Hematite var. Kidney Ore | Fe2O3 |
| Fe | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Fe | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| Fe | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Fe | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| Fe | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| Fe | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Fe | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| Fe | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Fe | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| Fe | ⓘ Kintoreite-Segnitite Series | |
| Fe | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Fe | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Fe | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| Fe | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Fe | ⓘ Nancyrossite | FeGeO6H5 |
| Co | Cobalt | |
| Co | ⓘ Carrollite | CuCo2S4 |
| Co | ⓘ Dolomite var. Cobalt-bearing Dolomite | (Ca,Mg,Co)CO3 |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Co | ⓘ Heterogenite | Co3+O(OH) |
| Co | ⓘ Linnaeite | Co2+Co23+S4 |
| Co | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| Co | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| Ni | Nickel | |
| Ni | ⓘ Brindleyite | (Ni,Al)3(Si,Al)2O5(OH)4 |
| Ni | ⓘ Millerite | NiS |
| Cu | Copper | |
| Cu | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Cu | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Cu | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Cu | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Briartite | Cu2FeGeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Cu | ⓘ Carrollite | CuCo2S4 |
| Cu | ⓘ Chalconatronite | Na2Cu(CO3)2 · 3H2O |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite var. Chalcotrichite | Cu2O |
| Cu | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| Cu | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| Cu | ⓘ Colusite | Cu13VAs3S16 |
| Cu | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Devilline | CaCu4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Djurleite | Cu31S16 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| Cu | ⓘ Famatinite | Cu3SbS4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Cu | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Cu | ⓘ Gallite | CuGaS2 |
| Cu | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Cu | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| Cu | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Cu | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Cu | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Cu | ⓘ Lammerite | Cu3(AsO4)2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Leightonite | K2Ca2Cu(SO4)4 · 2H2O |
| Cu | ⓘ Libethenite | Cu2(PO4)(OH) |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| Cu | ⓘ Luzonite | Cu3AsS4 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Cu | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Cu | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| Cu | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Cu | ⓘ Plancheite | Cu8(Si8O22)(OH)4 · H2O |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Roxbyite | Cu58S32 |
| Cu | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Cu | ⓘ Seligmannite | PbCuAsS3 |
| Cu | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Shattuckite | Cu5(Si2O6)2(OH)2 |
| Cu | ⓘ Spertiniite | Cu(OH)2 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Sulvanite | Cu3VS4 |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Tangeite | CaCu(VO4)(OH) |
| Cu | ⓘ Umangite | Cu3Se2 |
| Cu | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Cu | ⓘ Wroewolfeite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| Cu | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Cu | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Cu | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| Cu | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| Cu | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| Cu | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| Cu | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Carnevallite | Cu3GaS4 |
| Cu | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| Cu | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Cu | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Cu | ⓘ Calvertite | Cu5Ge0.5S4 |
| Cu | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Cu | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Cu | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Cu | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| Cu | ⓘ Hermannroseite | CaCu(PO4)(OH) |
| Cu | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Cu | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Cu | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| Cu | ⓘ Richardsite | Zn2CuGaS4 |
| Cu | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Austinite | CaZn(AsO4)(OH) |
| Zn | ⓘ Ashoverite | Zn(OH)2 |
| Zn | ⓘ Baileychlore | (Zn,Fe2+,Al,Mg)6(Si,Al)4O10(OH)8 |
| Zn | ⓘ Brianyoungite | Zn3(CO3,SO4)(OH)4 |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Chudobaite | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| Zn | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| Zn | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| Zn | ⓘ Fraipontite | (Zn,Al)3((Si,Al)2O5)(OH)4 |
| Zn | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| Zn | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| Zn | ⓘ Gunningite | ZnSO4 · H2O |
| Zn | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Zn | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Zn | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Ktenasite | ZnCu4(SO4)2(OH)6 · 6H2O |
| Zn | ⓘ Larsenite | PbZnSiO4 |
| Zn | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| Zn | ⓘ Leiteite | Zn(As2O4) |
| Zn | ⓘ Minrecordite | CaZn(CO3)2 |
| Zn | ⓘ Namuwite | Zn4(SO4)(OH)6 · 4H2O |
| Zn | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| Zn | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Paradamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Zn | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| Zn | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Zn | ⓘ Reinerite | Zn3(AsO3)2 |
| Zn | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Schulenbergite | (Cu,Zn)7(SO4)2(OH)10 · 3H2O |
| Zn | ⓘ Serpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| Zn | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Wurtzite | (Zn,Fe)S |
| Zn | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| Zn | ⓘ Zincrosasite | (Zn,Cu)2(CO3)(OH)2 |
| Zn | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| Zn | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| Zn | ⓘ Gordaite | NaZn4(SO4)(OH)6Cl · 6H2O |
| Zn | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| Zn | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| Zn | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| Zn | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| Zn | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Dolomite var. Zinc-bearing Dolomite | Ca(Mg,Zn)(CO3)2 |
| Zn | ⓘ Siderite var. Zinc-bearing Siderite | (Fe,Zn)CO3 |
| Zn | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Zn | ⓘ Aragonite var. Zinc-bearing Aragonite | (Ca,Zn)CO3 |
| Zn | ⓘ Skorpionite | Ca3Zn2(PO4)2(CO3)(OH)2 · H2O |
| Zn | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| Zn | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| Zn | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| Zn | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| Zn | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| Zn | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Zn | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Richardsite | Zn2CuGaS4 |
| Zn | ⓘ Zincostottite | ZnGe(OH)6 |
| Ga | Gallium | |
| Ga | ⓘ Gallite | CuGaS2 |
| Ga | ⓘ Söhngeite | Ga(OH)3 |
| Ga | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| Ga | ⓘ Carnevallite | Cu3GaS4 |
| Ga | ⓘ Tsumgallite | GaO(OH) |
| Ga | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Ga | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Ga | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Ga | ⓘ Richardsite | Zn2CuGaS4 |
| Ga | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Ge | Germanium | |
| Ge | ⓘ Argutite | GeO2 |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| Ge | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Ge | ⓘ Briartite | Cu2FeGeS4 |
| Ge | ⓘ Brunogeierite | Ge4+Fe22+O4 |
| Ge | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| Ge | ⓘ Germanite | Cu13Fe2Ge2S16 |
| Ge | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| Ge | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| Ge | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Ge | ⓘ Otjisumeite | PbGe4O9 |
| Ge | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| Ge | ⓘ Schaurteite | Ca3Ge(SO4)2(OH)6 · 4H2O |
| Ge | ⓘ Stottite | Fe2+[Ge4+(OH)6] |
| Ge | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Ge | ⓘ Eyselite | Fe3+Ge34+O7(OH) |
| Ge | ⓘ Krieselite | Al2(GeO4)F2 |
| Ge | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Ge | ⓘ Calvertite | Cu5Ge0.5S4 |
| Ge | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Ge | ⓘ Zincobriartite | Cu2(Zn,Fe)(Ge,Ga)S4 |
| Ge | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Ge | ⓘ Nancyrossite | FeGeO6H5 |
| Ge | ⓘ Zincostottite | ZnGe(OH)6 |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Arsenocrandallite | CaAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| As | ⓘ Arthurite | CuFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Austinite | CaZn(AsO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Chalcophyllite | Cu18Al2(AsO4)4(SO4)3(OH)24 · 36H2O |
| As | ⓘ Chenevixite | Cu2Fe23+(AsO4)2(OH)4 |
| As | ⓘ Chudobaite | (Mg,Zn)5(AsO4)2(HAsO4)2 · 10H2O |
| As | ⓘ Clinoclase | Cu3(AsO4)(OH)3 |
| As | ⓘ Claudetite | As2O3 |
| As | ⓘ Colusite | Cu13VAs3S16 |
| As | ⓘ Conichalcite | CaCu(AsO4)(OH) |
| As | ⓘ Cornwallite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Adamite var. Copper-bearing Adamite | (Zn,Cu)2AsO4OH |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Euchroite | Cu2(AsO4)(OH) · 3H2O |
| As | ⓘ Fahleite | CaZn5Fe23+(AsO4)6 · 14H2O |
| As | ⓘ Ferrilotharmeyerite | CaZnFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| As | ⓘ Gaitite | Ca2Zn(AsO4)2 · 2H2O |
| As | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| As | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| As | ⓘ Geminite | Cu2+(AsO3OH) · H2O |
| As | ⓘ Gerdtremmelite | (Zn,Fe)(Al,Fe)2(AsO4)(OH)5 |
| As | ⓘ Germanocolusite | Cu26V2(Ge,As)6S32 |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Gratonite | Pb9As4S15 |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| As | ⓘ Johillerite | Na(Mg,Zn)3Cu(AsO4)3 |
| As | ⓘ Karibibite | Fe33+(As3+O2)4(As23+O5)(OH) |
| As | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| As | ⓘ Koritnigite | Zn(AsO3OH) · H2O |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Lammerite | Cu3(AsO4)2 |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Legrandite | Zn2(AsO4)(OH) · H2O |
| As | ⓘ Leiteite | Zn(As2O4) |
| As | ⓘ Lindackerite | CuCu4(AsO4)2(HAsO4)2 · 9H2O |
| As | ⓘ Ludlockite | PbFe43+As103+O22 |
| As | ⓘ Luzonite | Cu3AsS4 |
| As | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| As | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| As | ⓘ O'Danielite | Na(Zn,Mg)3(AsO4)(AsO3OH)2 |
| As | ⓘ Ojuelaite | ZnFe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Paradamite | Zn2(AsO4)(OH) |
| As | ⓘ Parnauite | Cu9(AsO4)2(SO4)(OH)10 · 7H2O |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| As | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| As | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| As | ⓘ Prosperite | Ca2Zn4(AsO4)4 · H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Reinerite | Zn3(AsO3)2 |
| As | ⓘ Renierite | (Cu1+,Zn)11Fe4(Ge4+,As5+)2S16 |
| As | ⓘ Anorthoroselite | Ca2Co(AsO4)2 · 2H2O |
| As | ⓘ Schneiderhöhnite | Fe2+Fe33+As53+O13 |
| As | ⓘ Schultenite | Pb(HAsO4) |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| As | ⓘ Seligmannite | PbCuAsS3 |
| As | ⓘ Stranskiite | Zn2Cu(AsO4)2 |
| As | ⓘ Talmessite | Ca2Mg(AsO4)2 · 2H2O |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Warikahnite | Zn3(AsO4)2 · 2H2O |
| As | ⓘ Olivenite var. Zinc-bearing Olivenite | (Cu,Zn)2(AsO4)(OH) |
| As | ⓘ Zincroselite | Ca2Zn(AsO4)2 · 2H2O |
| As | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| As | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| As | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| As | ⓘ Calcioandyrobertsite | KCaCu5(AsO4)4(H2AsO4) · 2H2O |
| As | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| As | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| As | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| As | ⓘ Ekatite | (Fe3+,Fe2+,Zn)12(AsO3)6(AsO3,HSiO4)2(OH)6 |
| As | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| As | ⓘ Wilhelmkleinite | ZnFe23+(AsO4)2(OH)2 |
| As | ⓘ Yvonite | Cu(HAsO4) · 2H2O |
| As | ⓘ Lavendulan var. Zinclavendulan | NaCa(Cu,Zn)5(AsO4)4Cl · 5H2O |
| As | ⓘ Adamite var. Cobalt-bearing Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| As | ⓘ Lukrahnite | CaCuFe3+(AsO4)2(OH,H2O)2 |
| As | ⓘ Sewardite | CaFe23+(AsO4)2(OH)2 |
| As | ⓘ Zincolivenite | CuZn(AsO4)(OH) |
| As | ⓘ Bendadaite | Fe2+Fe23+(AsO4)2(OH)2 · 4H2O |
| As | ⓘ Stibioclaudetite | AsSbO3 |
| As | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| As | ⓘ Kintoreite-Segnitite Series | |
| As | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| As | ⓘ Arsenohopeite | Zn3(AsO4)2 · 4H2O |
| As | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| As | ⓘ Davidlloydite | Zn3(AsO4)2 · 4H2O |
| As | ⓘ Ianbruceite | Zn2(AsO4)(OH) · 3H2O |
| As | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| As | ⓘ Erikapohlite | Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O |
| As | ⓘ Mineral GS1 (of Gebhard) | Zn, Fe, As, O, H |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| As | ⓘ Tennantite-(Cu) | Cu6(Cu4Cu2)As4S12S |
| As | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Se | Selenium | |
| Se | ⓘ Berzelianite | Cu2-xSe (x ≈ 0.12) |
| Se | ⓘ Clausthalite | PbSe |
| Se | ⓘ Naumannite | Ag2Se |
| Se | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Se | ⓘ Umangite | Cu3Se2 |
| Se | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Se | ⓘ Plumboselite | Pb3O2(SeO3) |
| Br | Bromine | |
| Br | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Sr | Strontium | |
| Sr | ⓘ Arsenogoyazite | SrAl3(AsO4)(AsO3OH)(OH)6 |
| Sr | ⓘ Celestine | SrSO4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
| Mo | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| Mo | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| Mo | ⓘ Maikainite | Cu20(Fe,Cu)6Mo2Ge6S32 |
| Mo | ⓘ Betpakdalite-CaMg | [Ca2(H2O)17Mg(H2O)6][Mo8As2Fe33+O36(OH)] |
| Mo | ⓘ Halilsarpite | [Mg(H2O)6][CaAs23+(Fe3+2.67Mo6+0.33)(AsO4)2O7] |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Eugenite | Ag11Hg2 |
| Ag | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Mckinstryite | Ag5-xCu3+xS4 |
| Ag | ⓘ Naumannite | Ag2Se |
| Ag | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Ag | ⓘ Cupropearceite | [Cu6As2S7][Ag9CuS4] |
| Ag | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Cd | Cadmium | |
| Cd | ⓘ Greenockite | CdS |
| Cd | ⓘ Keyite | Cu32+Zn4Cd2(AsO4)6 · 2H2O |
| Cd | ⓘ Otavite | CdCO3 |
| Cd | ⓘ Andyrobertsite | KCdCu5(AsO4)4(H2AsO4) · 2H2O |
| Cd | ⓘ Niedermayrite | CdCu4(SO4)2(OH)6 · 4H2O |
| Cd | ⓘ Edwardsite | Cu3Cd2(SO4)2(OH)6 · 4H2O |
| Cd | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| Cd | ⓘ Lazaridisite | 3CdSO4 · 8H2O |
| Cd | ⓘ Lauraniite | Cu6Cd2(SO4)2(OH)12 · 5H2O |
| Cd | ⓘ Cadsulfohite | Cd2(SO4)(OH)2 |
| In | Indium | |
| In | ⓘ Dzhalindite | In(OH)3 |
| Sn | Tin | |
| Sn | ⓘ Jeanbandyite | Fex3+Fe2+1-xSn(OH)6-xOx |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sn | ⓘ Mawsonite | Cu6Fe2SnS8 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Famatinite | Cu3SbS4 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Nadorite | PbSbClO2 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Biehlite | ((Sb,As)O)2[MoO4] |
| Sb | ⓘ Stibioclaudetite | AsSbO3 |
| Sb | ⓘ Cupropolybasite | [Cu6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| I | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Romanèchite | (Ba,H2O)2(Mn4+,Mn3+)5O10 |
| Ba | ⓘ Vésigniéite | BaCu3(VO4)2(OH)2 |
| Ba | ⓘ Witherite | BaCO3 |
| Ce | Cerium | |
| Ce | ⓘ Agardite-(Ce) | CeCu6(AsO4)3(OH)6 · 3H2O |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Stolzite | Pb(WO4) |
| W | ⓘ Tungstenite | WS2 |
| W | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| W | ⓘ Ovamboite | Cu20(Fe,Cu,Zn)6W2Ge6S32 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Eugenite | Ag11Hg2 |
| Hg | ⓘ Metacinnabar | HgS |
| Hg | ⓘ Perroudite | Hg5Ag4S5(I,Br)2Cl2 |
| Pb | Lead | |
| Pb | ⓘ Alamosite | PbSiO3 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Arsentsumebite | Pb2Cu(AsO4)(SO4)(OH) |
| Pb | ⓘ Bartelkeite | Pb(Fe2+Ge)[Ge2O7](OH)2 · H2O |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Beaverite-(Cu) | Pb(Fe23+Cu)(SO4)2(OH)6 |
| Pb | ⓘ Betekhtinite | Pb2(Cu,Fe)22-24S15 |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Caledonite | Pb5Cu2(SO4)3(CO3)(OH)6 |
| Pb | ⓘ Carminite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Clausthalite | PbSe |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Dundasite | PbAl2(CO3)2(OH)4 · H2O |
| Pb | ⓘ Elyite | Pb4Cu(SO4)O2(OH)4 · H2O |
| Pb | ⓘ Fleischerite | Pb3Ge(SO4)2(OH)6 · 3H2O |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Freedite | Cu+Pb8(AsO3)2O3Cl5 |
| Pb | ⓘ Furutobeite | (Cu,Ag)6PbS4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Gartrellite | PbCuFe3+(AsO4)2(OH) · H2O |
| Pb | ⓘ Gebhardite | Pb8(As2O5)2OCl6 |
| Pb | ⓘ Gratonite | Pb9As4S15 |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Helmutwinklerite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Hidalgoite | PbAl3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Hinsdalite | PbAl3(PO4)(SO4)(OH)6 |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Itoite | Pb3Ge4+(SO4)2O2(OH)2 |
| Pb | ⓘ Jamesite | Pb2Zn(Fe2+,Zn)2Fe43+(AsO4)4(OH)10 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Pb | ⓘ Kegelite | Pb8Al4(Si8O20)(SO4)2(CO3)4(OH)8 |
| Pb | ⓘ Kintoreite | PbFe3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Lanarkite | Pb2(SO4)O |
| Pb | ⓘ Larsenite | PbZnSiO4 |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Ludlockite | PbFe43+As103+O22 |
| Pb | ⓘ Macphersonite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Massicot | PbO |
| Pb | ⓘ Mathewrogersite | Pb7FeAl3GeSi12O36(OH,H2O)6 |
| Pb | ⓘ Matlockite | PbFCl |
| Pb | ⓘ Mawbyite | PbFe23+(AsO4)2(OH)2 |
| Pb | ⓘ Melanotekite | Pb2Fe23+(Si2O7)O2 |
| Pb | ⓘ Mendipite | Pb3Cl2O2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Minium | Pb3O4 |
| Pb | ⓘ Molybdofornacite | Pb2Cu(MoO4,CrO4)(AsO4,PO4)(OH) |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Nadorite | PbSbClO2 |
| Pb | ⓘ Olsacherite | Pb2(Se6+O4)(SO4) |
| Pb | ⓘ Otjisumeite | PbGe4O9 |
| Pb | ⓘ Parkinsonite | Pb7MoO9Cl2 |
| Pb | ⓘ Philipsbornite | PbAl3(AsO4)(AsO3OH)(OH)6 |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plumbotsumite | Pb13(CO3)6(Si10O27) · 3H2O |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumbojarosite | Pb0.5Fe33+(SO4)2(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Queitite | Pb4Zn2(SO4)(SiO4)(Si2O7) |
| Pb | ⓘ Schultenite | Pb(HAsO4) |
| Pb | ⓘ Scotlandite | PbSO3 |
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
| Pb | ⓘ Seligmannite | PbCuAsS3 |
| Pb | ⓘ Stolzite | Pb(WO4) |
| Pb | ⓘ Surite | (Pb,Ca)3(Al,Fe2+,Mg)2((Si,Al)4O10)(CO3)2(OH)2 |
| Pb | ⓘ Susannite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Aragonite var. Lead-bearing Aragonite | (Ca,Pb)CO3 |
| Pb | ⓘ Thometzekite | PbCu22+(AsO4)2 · 2H2O |
| Pb | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Duftite-alpha | PbCu(AsO4)(OH) |
| Pb | ⓘ Arsenbrackebuschite | Pb2Fe3+(AsO4)2(OH) |
| Pb | ⓘ Feinglosite | Pb2Zn(AsO4)2 · H2O |
| Pb | ⓘ Gallobeudantite | PbGa3(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Zincgartrellite | PbZn2(AsO4)2(H2O,OH)2 |
| Pb | ⓘ Cobalttsumcorite | PbCo2(AsO4)2 · 2H2O |
| Pb | ⓘ Sidpietersite | Pb42+(S2O3)O2(OH)2 |
| Pb | ⓘ Wulfenite var. Chillagite | Pb[(Mo,W)O4] |
| Pb | ⓘ Hydroxylpyromorphite | Pb5(PO4)3(OH) |
| Pb | ⓘ Munakataite | Pb2Cu2(Se4+O3)(SO4)(OH)4 |
| Pb | ⓘ Kintoreite-Segnitite Series | |
| Pb | ⓘ Plumbogummite var. Ga-rich plumbogummite | Pb(Al,Ga)3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Plumboselite | Pb3O2(SeO3) |
| Pb | ⓘ Yancowinnaite | PbCuAl(AsO4)2OH · H2O |
| Pb | ⓘ Vanackerite | Pb4Cd(AsO4)3Cl |
| Pb | ⓘ Galloplumbogummite | Pb(Ga,Al,Ge)3(PO4)2(OH)6 |
| Pb | ⓘ Oxyplumboroméite | Pb2Sb2O6O |
| Pb | ⓘ Abellaite | NaPb2(CO3)2(OH) |
| Pb | ⓘ Karlseifertite | Pb(Ga2Ge)(AsO4)2(OH)6 |
| Bi | Bismuth | |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| U | Uranium | |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Metazeunerite | Cu(UO2)2(AsO4)2 · 8H2O |
Other Databases
| Link to USGS MRDS: | 10089357 |
|---|
Mindat Articles
New minerals for the Tsumeb mine, Namibia by Joy DesorRichard Gunter Catalogue Leadhillite Tsumeb by Richard Gunter
Richard Gunter Catalogue Tennantite-(Zn) by Richard Gunter
Localities in this Region
- Oshikoto Region
- Tsumeb
- Tsumeb Mine (Ongopolo Mine)
- Tsumeb
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Rosický, V. (1913) Preslit, ein neues Mineral von Tsumeb in Deutsch-Südwestafrika. Zeitschrift für Kristallographie, 51 (1). 521 doi:10.1524/zkri.1913.51.1.521(as Preslite)
Tofoorffy, Z. v. (1913) Über Kupferlasur und Weißbleierz von Tsumeb. Zeitschrift für Kristallographie, 52 (1-6). 225-237 doi:10.1524/zkri.1913.52.1.225
Tofoorffy, Z. v. (1913) Über Kupferlasur und Weißbleierz von Tsumeb. Zeitschrift für Kristallographie, 52 (1-6). 225-237 doi:10.1524/zkri.1913.52.1.225
Thomson, Ellis (1917) Azurite from Tsumeb, Ambo-land, Southwest Africa. American Mineralogist, 2 (4) 46-48
Goldschmidt, V., Thomson, E. (1920) Tetragonal system. Phosgenite from Tsumeb, Ambo-land, Southwest Africa. American Mineralogist, 5 (7) 131-132
Rosický, Vojtěch, Rosický, Vojtěch (1926) Sur l'anglésite de Tsumeb, Otavi (Afrique Sud˗Orientale) Bulletin de Minéralogie, 49 (7) 160-163 doi:10.3406/bulmi.1926.4007
Spencer, L. J., Mountain, E. D. (1926) Schultenite, a new mineral, from South-West Africa. Mineralogical Magazine and Journal of the Mineralogical Society, 21 (115) 149-155 doi:10.1180/minmag.1926.021.115.02
Palache, Charles, Lewis, Lyman W. (1927) Crystallography of azurite from Tsumeb, Southwest Africa, and the axial ratio of azurite. American Mineralogist, 12 (4) 99-143
Kingsbury, Arthur W. G., Hartley, J. (1957) New occurrences of rosasite in Britain. Mineralogical Magazine and Journal of the Mineralogical Society, 31 (237). 501-502 doi:10.1180/minmag.1957.031.237.14(referring to rosasite from Tsumeb)
Strunz, H., Giglio, M. (1961) Die Kristallstruktur von Stottit Fe[Ge(OH)6]. Acta Crystallographica, 14 (3) 205-208 doi:10.1107/s0365110x61000723
Walenta, K., Wimmenauer, W. (1961) Der Mineralbestand des Michaelganges im Weiler bei Lahr (Schwarzwald). Jahreshefte des Geologischen Landesamts Baden-Württemberg: 4: 7-37 (in German).[tsumcorite, as unnamed Pb-Zn-arsenate]
Strunz, H. (1965) Söhngeit, Ga(OH)3, ein neues Mineral. Die Naturwissenschaften, 52 (17). 493 doi:10.1007/bf00646572
Geier, B.H., Ottemann, J. (1970) New primary vanadium-, germanium-, gallium-, and tin-minerals from the Pb-Zn-Cu-deposit Tsumeb, South West Africa. Mineralium Deposita, 5 (1). 29-40 doi:10.1007/bf00207004("carnevallite", "Maigruen", "Feurmineral", "LU")
Medenbach, O., Schmetzer, K. (1975) Kegelite - ein neues Bleisilikat von Tsumeb. Naturwissenschaften: 62: 137. (in German with English abstract)(Abstracted in Fleischer et al. (1976) New Mineral Names. American Mineralogist: 61(1-2): 174-186 (pages 175-176). https://rruff.info/rruff_1.0/uploads/AM61_174.pdf)
Fleischer, M., Mandarino, A. (1977) New mineral names. American Mineralogist, 62 (1-2). 173-176 pp.175-176
Hänni, Henry A., Stern, Willem B., Glor, Martin (1978) New data on stranskiite from Tsumeb, Southwest Africa. American Mineralogist, 63 (1-2) 213-215
Fleischer, Michael, Burns, Roger G., Cabri, Louis J., Chao, George Y., Hogarth, D. D., Pabst, Adolf (1979) New Mineral Names. American Mineralogist, 64 (11-12) 1329-1334 p.1331
Gait, Robert I., Sturman, B. Darko, Dunn, Pete J. (1979) Prosperite, HCaZn2(AsO4)2(OH), a new mineral from Tsumeb, South West Africa (Namibia) The Canadian Mineralogist, 17 (1) 87-92
Fleischer, M., Mandarino, J.A., and Pabst, A. (1980) New mineral names. American Mineralogist: 65: 205-210.p.208 - (prosperite)
(1980) International Mineralogical Association: Commission on New Minerals and Mineral Names. Mineralogical Magazine, 43 (332) 1053-1055 doi:10.1180/minmag.1980.043.332.17
Sturman, B. Darko, Dunn, Pete J. (1980) Gaitite, H2Ca2Zn(AsO4)2(OH)2, a new mineral from Tsumeb, Namibia. The Canadian Mineralogist, 18 (2) 197-200
Hess, Heinz, Keller, Paul (1980) Die Kristallstruktur von Queitit, Pb4Zn2[SO4|SiO4|Si2O7]. Zeitschrift für Kristallographie, 151 (3-4). 287-299 doi:10.1524/zkri.1980.151.3-4.287
Fleischer, Michael, Chao, George Y., Francis, Carl A., Pabst, and Adolf (1981) New Mineral Names. American Mineralogist, 66 (1-2) 217-220 O'Danielite, unnamed arsenate
Fleischer, Michael, Cabri, Louis J. (1981) New Mineral Names. American Mineralogist, 66 (11-12) 1274-1280 (gaitite, jamesite, o'danielite)
Fleischer, M., Burns, R.G., Cabri, L.J., Francis, C.A., Pabst, A. (1982) New mineral names. American Mineralogist, 67, 413-418.p.413 - (bartelkeite)
Dunn, Pete J., Keller, Paul (1982) Arsendescloizite, a new mineral from Tsumeb [Namibia]. The Mineralogical Record, 13 (3) 155-157
Keller, Paul, Riffel, Heinz, Hess, Heinz (1982) Die Kristallstruktur von Prosperit, Ca2Zn4[H2O|(AsO4)4]. Zeitschrift für Kristallographie, 158 (1). 33-42 doi:10.1524/zkri.1982.0003
Haynes, Frederick M. (1984) A geochemical model for sulfide paragenesis and zoning in the CuFeAsS system (Tsumeb, South West Africa/Namibia) Chemical Geology, 47 (3) 183-190 doi:10.1016/0009-2541(84)90125-6
Ii, Charles R. Ross, Bernstein, Lawrence R., Waychunas, Glenn A. (1988) Crystal-structure refinement of stottite, FeGe(OH)6. American Mineralogist, 73 (5-6) 657-661
Dunn, Pete J., Braithwaite, Richard S. W., Roberts, Andrew C., Ramik, Robert A. (1990) Kegelite from Tsumeb, Namibia: A redefinition. American Mineralogist, 75 (5-6) 702-704
Ansell, Valerie E., Ansell, Gary H., Roberts, Andrew C., Dunn, Pete J., Birch, William D., Grice, Joel D. (1992) Ferrilotharmeyerite, a new Ca-Zn-Fe3+ hydroxyl arsenate from Tsumeb, Namibia. The Canadian Mineralogist, 30 (1) 225-227
Groat, Lee A. (1996) The crystal structure of namuwite, a mineral with Zn in tetrahedral and octahedral coordination, and its relationship to the synthetic basic zinc sulfates. American Mineralogist, 81 (1) 238-243 doi:10.2138/am-1996-1-229
Jambor, J. L., Owens, D. R., Grice, J. D., Feinglos, M. N. (1996) Gallobeudantite, PbGa3[(AsO4),(SO4)]2(OH)6, a new mineral species from Tsumeb, Namibia, and associated new gallium analogues of the alunite-jarosite family. The Canadian Mineralogist, 34 (6) 1305-1315
Clark, A. M., Criddle, A. J., Roberts, A. C., Bonardi, M., Moffatt, E. A. (1997) Feinglosite, a new mineral related to brackebuschite, from Tsumeb, Namibia. Mineralogical Magazine, 61 (405) 285-289 doi:10.1180/minmag.1997.061.405.11
Krause, Werner, Belendorff, Klaus, Bernhardt, Heinz-Jürgen, Mccammon, Catherine, Effenberger, Herta, Mikenda, Werner (1998) Crystal chemistry of the tsumcorite-group minerals. New data on ferrilotharmeyerite, tsumcorite, thometzekite, mounanaite, helmutwinklerite, and a redefinition of gartrellite. European Journal of Mineralogy, 10 (2). 179-206 doi:10.1127/ejm/10/2/0179
Roberts, Andrew C., Cooper, Mark A., Hawthorne, Frank C., Criddle, Alan J., Stanley, Christopher J., Key, Charles L., Jambor, John L. (1999) Sidpietersite, Pb2+4(S6+O3S2-)O2(OH)2, a new thiosulfate-bearing mineral species from Tsumeb, Namibia. The Canadian Mineralogist, 37 (5) 1269-1273
Cooper, M. A., Hawthorne, F. C. (1999) The structure topology of sidpietersite, Pb2+4(S6+O3S2-)O2(OH)2, a novel thiosulfate structure. The Canadian Mineralogist, 37 (5) 1275-1282
Cooper, Mark A., Hawthorne, Frank C., Pinch, William W., Grice, Joel D. (1999) Andyrobertsite and Calcioandyrobertsite: Two New Minerals from the Tsumeb Mine, Tsumeb, Namibia. The Mineralogical Record, 30 (3) 181-186
Kamona, A. F., Lévêque, J., Friedrich, G., Haack, U. (1999) Lead isotopes of the carbonate-hosted Kabwe, Tsumeb, and Kipushi Pb-Zn-Cu sulphide deposits in relation to Pan African orogenesis in the Damaran-Lufilian Fold Belt of Central Africa. Mineralium Deposita, 34 (3). 273-283 doi:10.1007/s001260050203
Jambor, John L., Pertsev, Nikolai N., Roberts, Andrew C. (2000) New Mineral Names. American Mineralogist, 85. 1321-1325 (andyrobertsite, calcioandyrobertsite, sidpietersite)
Chetty, D., Frimmel, H. E. (2000) The role of evaporites in the genesis of base metal sulphide mineralisation in the Northern Platform of the Pan-African Damara Belt, Namibia: geochemical and fluid inclusion evidence from carbonate wall rock alteration. Mineralium Deposita, 35 (4) 364-376 doi:10.1007/s001260050247
Cooper, M. A., Hawthorne, F. C. (2000) Highly undersaturated anions in the crystal structure of andyrobertsite - calcio-andyrobertsite, a doubly acid arsenate of the form K(Cd,Ca)[Cu2+5(AsO4)4](H2O)2. The Canadian Mineralogist, 38 (4) 817-830 doi:10.2113/gscanmin.38.4.817
Effenberger, H., Krause, W., Bernhardt, H.-J., Martin, M. (2000) On the symmetry of tsumcorite group minerals based on the new species rappoldite and zincgartrellite. Mineralogical Magazine, 64 (6). 1109-1126 doi:10.1180/002646100549922
Cook, Robert B. (2001) Connoisseur's Choice: Mimetite, Tsumeb, Namibia. Rocks & Minerals, 76 (2) 114-117 doi:10.1080/00357520109603204
Keller, Paul (2001) Ekatite, (Fe3+,Fe2+,Zn)12(OH)6[AsO3]6[AsO3,HOSiO3]2, a new mineral from Tsumeb, Namibia, and its crystal structure. European Journal of Mineralogy, 13 (4) 769-777 doi:10.1127/0935-1221/2001/0013-0769
Roberts, A. C., Cooper, M. A., Hawthorne, F. C., Criddle, A. J., Stirling, J. A.R. (2002) Sewardite, CaFe3+2(AsO4)2(OH)2, the Ca-analogue of carminite, from Tsumeb, Namibia: description and crystal structure. The Canadian Mineralogist, 40 (4) 1191-1198 doi:10.2113/gscanmin.40.4.1191
Roberts, A. C., Seward, T. M., Reusser, E., Carpenter, G. J.C., Grice, J. D., Clark, S. M., Marcus, M. A. (2004) Eyselite, Fe3+Ge4+3O7(OH), a new mineral species from Tsumeb, Namibia. The Canadian Mineralogist, 42 (6) 1771-1776 doi:10.2113/gscanmin.42.6.1771
Keller, Paul, Lissner, Falk, Schleid, Thomas (2005) Single-crystal structure determination of perroudite, Hg5Ag4S5(I, Br)2Cl2, from Tsumeb (Namibia), and its structural relationships to other sulfide halides of mercury and cinnabar. Neues Jahrbuch für Mineralogie - Abhandlungen, 181 (1) 1-9 doi:10.1127/0077-7757/2005/0181-0004
Wagner, T., Monecke, T. (2005) Germanium-bearing colusite from the Waterloo volcanic-rock-hosted massive sulfide deposit, Australia: crystal chemistry and formation of colusite-group minerals. The Canadian Mineralogist, 43 (2). 655-669 doi:10.2113/gscanmin.43.2.655
Cook, Robert B. (2006) Connoisseur's Choice: Covellite, Summitville, Rio Grande County, Colorado. Rocks & Minerals, 81 (4) 296-300 doi:10.3200/rmin.81.4.296-300
Boni, M., Terracciano, R., Evans, N. J., Laukamp, C., Schneider, J., Bechstadt, T. (2007) Genesis of vanadium ores in the Otavi Mountainland, Namibia. Economic Geology, 102 (3). 441-469 doi:10.2113/gsecongeo.102.3.441
Origlieri, Marcus, Downs, Robert T., Pinch, William W., Zito, Gary L. (2009) Stibioclaudetite, a new mineral from Tsumeb, Namibia. The Mineralogical Record, 40 (3) 209-213
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2010) New minerals and nomenclature modifications approved in 2010. CNMNC Newsletter No 3. Mineralogical Magazine, 74 (3) 577-579 doi:10.1180/s0026461x00054979
Schlüter, Jochen, Geisler, Thorsten, Pohl, Dieter, Stephan, Thomas (2010) Krieselite, Al2GeO4(F,OH)2: A new mineral from the Tsumeb mine, Namibia, representing the Ge analogue of topaz. Neues Jahrbuch für Mineralogie - Abhandlungen, 187 (1) 33-40 doi:10.1127/0077-7757/2010/0160
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011, CNMNC Newsletter No. 10. Mineralogical Magazine, 75 (5) 2549-2561 doi:10.1180/minmag.2011.075.5.2549
Kampf, Anthony R., Mills, Stuart J., Pinch, William W. (2011) Plumboselite, Pb3O2(SeO3), a new oxidation-zone mineral from Tsumeb, Namibia. Mineralogy and Petrology, 101 (1) 75-80 doi:10.1007/s00710-010-0137-3
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) New minerals and nomenclature modifications approved in 2011. CNMNC Newsletter No 9. Mineralogical Magazine, 75 (4) 2535-2540 doi:10.1180/minmag.2011.075.4.2535
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2011) IMA Commission on New Minerals, Nomenclature and Classification (CNMNC) Newsletter 8. Mineralogical Magazine, 75 (2) 289-294 doi:10.1180/minmag.2011.075.2.289
Schlüter, Jochen, Pohl, Dieter, Gebhard, Georg (2011) The new mineral hermannroseite, CaCu(PO4,AsO4)(OH), the phosphate analogue of conichalcite, from Tsumeb, Namibia. Neues Jahrbuch für Mineralogie - Abhandlungen, 188 (2) 135-140 doi:10.1127/0077-7757/2011/0186
Hawthorne, Frank C., Cooper, Mark A., Abdu, Yassir A., Ball, Neil A., Back, Malcolm E., Tait, Kim T. (2012) Davidlloydite, ideally Zn3(AsO4)2(H2O)4, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (1) 45-57 doi:10.1180/minmag.2012.076.1.45
Williams, P. A., Hatert, F., Pasero, M., Mills, S. J. (2012) New minerals and nomenclature modifications approved in 2012. CNMNC Newsletter No 13. Mineralogical Magazine, 76 (3) 807-817 doi:10.1180/minmag.2012.076.3.26
Neuhold, F., Kolitsch, U., Bernhardt, H.-J., Lengauer, C. L. (2012) Arsenohopeite, a new zinc arsenate mineral from the Tsumeb mine, Namibia. Mineralogical Magazine, 76 (3) 603-612 doi:10.1180/minmag.2012.076.3.11
Cooper, M. A., Abdu, Y. A., Ball, N. A., Hawthorne, F. C., Back, M. E., Tait, K. T., Schlüter, J., Malcherek, T., Pohl, D., Gebhard, G. (2012) Ianbruceite, ideally [Zn2(OH)(H2O)(AsO4)](H2O)2, a new arsenate mineral from the Tsumeb mine, Otjikoto (Oshikoto) region, Namibia: description and crystal structure. Mineralogical Magazine, 76 (5) 1119-1131 doi:10.1180/minmag.2012.076.5.05
Schlüter, Jochen, Malcherek, Thomas, Mihailova, Boriana, Gebhard, Georg (2013) The new mineral erikapohlite, Cu3(Zn,Cu,Mg)4Ca2(AsO4)6 · 2H2O, the Ca-dominant analogue of keyite, from Tsumeb, Namibia. Neues Jahrbuch für Mineralogie - Abhandlungen, 190 (3) 319-325 doi:10.1127/0077-7757/2013/0239
www.mineralienatlas.de (2013) https://www.mineralienatlas.de/lexikon/index.php/Namibia/Oshikoto%20%28Otjikoto%29%2C%20Region/Tsumeb/Tsumeb%20Mine
Schlüter, Jochen, Malcherek, Thomas, Mihailova, Boriana (2014) Galloplumbogummite from Tsumeb, Namibia, a new member of the alunite group with tetravalent charge balance. Neues Jahrbuch für Mineralogie - Abhandlungen Journal of Mineralogy and Geochemistry, 191 (3) 301-309 doi:10.1127/0077-7757/2014/0262
Schlüter, Jochen, Malcherek, Thomas, Gebhard, Georg (2016) Vanackerite, a new lead cadmium arsenate of the apatite supergroup from Tsumeb, Namibia. Neues Jahrbuch für Mineralogie - Abhandlungen: Journal of Mineralogy and Geochemistry, 193 (1) 79-86 doi:10.1127/njma/2015/0294
Southwood, Malcolm, Števko, Martin, Carr, Paul (2020) Tsumeb: Zincolivenite and the Adamite-Olivenite Series. Rocks & Minerals, 95 (3) 210-233 doi:10.1080/00357529.2020.1716168
Southwood, Malcolm (2021) Connoisseur's Choice: Alamosite, Tsumeb, Namibia. Rocks & Minerals, 96 (2). 158-163 doi:10.1080/00357529.2021.1848218
Cairncross, Bruce (2021) Connoisseur's Choice: Mimetite after Cerussite (Part 2), Tsumeb Mine, Namibia. Rocks & Minerals, 96 (4) 352-357 doi:10.1080/00357529.2021.1901209
Quick NavTopCommoditiesMineral ListRock TypesOther DatabasesArticlesLocalities in RegionOther RegionsReferences





Tsumeb Mine, Tsumeb, Oshikoto Region, Namibia